HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
N,N,N',N',N'',N''-Hexamethylmethantriamin
Tris(dimethylamino)methane · Tris(N,N-dimethylamino)methane · Tris(dimethylamino)methane,85% · Tris(dimethylamino)methane 97% · Tris(dimethylamino) methane, 96%+ · Tris(diMethylaMino)Methane, 85% 5GR · N,N,N,N,N,N-HEXAMETHYLMETHANETRIAMINE · N,N',N''-Methylidynetris(dimethylamine)
Identifikatoren & physikalische Daten
| CAS No. | 5762-56-1 |
|---|---|
| Summenformel | C7H19N3 |
| Durchschnittliche Molmasse | 145,25 g/mol |
| Monoisotopische Masse | 145,15789761 g/mol |
| SMILES | CN(C)C(N(C)C)N(C)C |
| InChIKey | MUMVIYLVHVCYGI-UHFFFAOYSA-N |
| PubChem CID | 79831 |
| ChEMBL | CHEMBL3301703 |
| EC No. | 227-284-0 |
| DTXSID | DTXSID20206284 |
| Lokaler Name | N,N,N',N',N'',N''-Hexamethylmethantriamin |
Chemische & physikalische Eigenschaften
| XLogP | 0,6 |
|---|---|
| Polarare Oberfläche (TPSA) | 9,7 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 3 |
| Frei drehbare Bindungen | 3 |
| Schwere Atome | 10 |
| Formalladung | 0 |
| Komplexität | 69,8 |
| Siedepunkt | 42-43 °C/12 mmHg (lit.) |
| Dichte | 0.838 g/mL at 20 °C (lit.) |
| Brechungsindex | n20/D 1.436(lit.) |
| Flammpunkt | 4 °F |
| Lagerbedingungen | 2-8°C |
| Aggregatzustand | Liquid |
| pKa (Säurekonstante) | 6.50±0.38(Predicted) |
| Farbe | Clear colorless to slightly yellow |
| BRN | 1901162 |
| InChI | InChI=1S/C7H19N3/c1-8(2)7(9(3)4)10(5)6/h7H,1-6H3 |
| InChIKey | MUMVIYLVHVCYGI-UHFFFAOYSA-N |
| SMILES | C(N(C)C)(N(C)C)N(C)C |
Sicherheit & Vorschriften
| GHS-Einstufung | DangerH225 (100%): Highly Flammable liquid and vapor [Danger Flammable liquids]P210, P233, P240, P241, P242, P243, P260, P264, P280, P301+P330+P331, P302+P361+P354, P303+P361+P353, P304+P340, P305+P354+P338, P316, P321, P363, P370+P378, P403+P235, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 42 reports by companies from 2 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Flam. Liq. 2 (100%) |
| F | 3-8-10-21 |
| Wassergefährdungsklasse (WGK) | 3 |
| UN-Transportnummer | UN 2733 3/PG 2 |
| Zollcode | 29212900 |
| R-Sätze (R) | 11-34 |
| Gefahrensymbole | F,C |
| hazard_note | Corrosive/Highly Flammable |
| Sicherheitshinweise (S) | 16-26-36/37/39-45 |
| Gefahrenklasse | 3.1Flam. Liq. 2Skin Corr. 1B |
| Verpackungsgruppe | II |
| Lagerklasse | 3 - Flammable liquids |
Anwendungen & Verwendung
Verwenden
Tris(dimethylamino)methane was used:to prepare the phosphoramidite derivative of the new nucleoside analogas reagent for the introduction of the dimethylaminoethylidene group in ring-opening (RO) polymerization of lactide