HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
HCID 798455Erstellt: 30. Oktober 2026
Carbamic acid, (5-(aminoacetyl)-10,11-dihydro-5H-dibenz(b,f)azepin-3-yl)-, ethyl ester
https://huagongshe.com/de/chemical/798455
Identifikatoren & physikalische Daten
| CAS No. | 132900-42-6 |
|---|
| Summenformel | C19H21N3O3 |
|---|
| Durchschnittliche Molmasse | 339,4 g/mol |
|---|
| Monoisotopische Masse | 339,15829154 g/mol |
|---|
| SMILES | CCOC(=O)Nc1ccc2c(c1)N(C(=O)CN)c1ccccc1CC2 |
|---|
| InChIKey | HJGLLZCKMKRCLO-UHFFFAOYSA-N |
|---|
| PubChem CID | 798455 |
|---|
| ChEMBL | CHEMBL1497437 |
|---|
| DTXSID | DTXSID40157845 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 2,2 |
|---|
| Polarare Oberfläche (TPSA) | 84,7 |
|---|
| H-Brücken-Donoren | 2 |
|---|
| H-Brücken-Akzeptoren | 4 |
|---|
| Frei drehbare Bindungen | 4 |
|---|
| Schwere Atome | 25 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 485 |
|---|
| Löslichkeit | 36.6 [ug/mL] (The mean of the results at pH 7.4) |
|---|
