HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
[4-[(4,6-Diamino-1,3,5-triazin-2-yl)amino]phenyl]arsonsure
N-(4,6-DIAMINO-1,3,5-TRIAZIN-2-YL)ARSANILIC ACID · [4-[(4,6-diamino-1,3,5-triazin-2-yl)amino]phenyl]arsonic acid · Arsonic acid, [4-[(4,6-diamino-1,3,5-triazin-2-yl)amino]phenyl]- (9CI)
![Molekülstruktur von [4-[(4,6-Diamino-1,3,5-triazin-2-yl)amino]phenyl]arsonsure](/img/chemical/79871.png)
Identifikatoren & physikalische Daten
| CAS No. | 3599-28-8 |
|---|---|
| Summenformel | C9H11AsN6O3 |
| Durchschnittliche Molmasse | 326,14 g/mol |
| Monoisotopische Masse | 326,010858 g/mol |
| SMILES | Nc1nc(N)nc(Nc2ccc([As](=O)(O)O)cc2)n1 |
| InChIKey | VURSAWSSSICZRY-UHFFFAOYSA-N |
| PubChem CID | 79871 |
| EC No. | 222-749-4 |
| DTXSID | DTXSID40206786 |
| Lokaler Name | [4-[(4,6-Diamino-1,3,5-triazin-2-yl)amino]phenyl]arsonsure |
Chemische & physikalische Eigenschaften
| Polarare Oberfläche (TPSA) | 160 |
|---|---|
| H-Brücken-Donoren | 5 |
| H-Brücken-Akzeptoren | 9 |
| Frei drehbare Bindungen | 3 |
| Schwere Atome | 19 |
| Formalladung | 0 |
| Komplexität | 335 |
| Lagerbedingungen | Refrigerator, under inert atmosphere |
| Löslichkeit | DMSO, Water |
| Aggregatzustand | Solid |
| Farbe | Off-White |
Sicherheit & Vorschriften
| Regulatorische Informationen | Restricted substance: [4-[(4,6-diamino-1,3,5-triazin-2-yl)amino]phenyl]arsonic acidRestricted substance: Disodium [4-[(4,6-diamino-1,3,5-triazin-2-yl)amino]phenyl]arsonate |
|---|
Anwendungen & Verwendung
Verwenden
[4-[(4,6-Diamino-1,3,5-triazin-2-yl)amino]phenyl]arsonic Acid is an intermediate in the synthesis of Melarsoprol (M215100), a drug used for the treatment of Arican trypanosomes, a sleeping sickness in humans, a disease that is typically fatal without chemotherapy.