HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Propionohydrazid
PROPIONOHYDRAZIDE · AKOS B015434 · propiohydrazide · Propanohydrazide · PROPANEHYDRAZIDE · propanoichydrazide · Propionic hydrazide · ART-CHEM-BB B015434
Identifikatoren & physikalische Daten
| CAS No. | 5818-15-5 |
|---|---|
| Summenformel | C3H8N2O |
| Durchschnittliche Molmasse | 88,11 g/mol |
| Monoisotopische Masse | 88,06366288 g/mol |
| SMILES | CCC(=O)NN |
| InChIKey | DXGIRFAFSFKYCF-UHFFFAOYSA-N |
| PubChem CID | 79890 |
| EC No. | 227-390-7 |
| DTXSID | DTXSID60206905 |
| Lokaler Name | Propionohydrazid |
Chemische & physikalische Eigenschaften
| XLogP | -0,7 |
|---|---|
| Polarare Oberfläche (TPSA) | 55,1 |
| H-Brücken-Donoren | 2 |
| H-Brücken-Akzeptoren | 2 |
| Frei drehbare Bindungen | 1 |
| Schwere Atome | 6 |
| Formalladung | 0 |
| Komplexität | 52,8 |
| LogP (Verteilungskoeffizient) | -1.0 |
| Schmelzpunkt | 179-180 °C |
| Siedepunkt | 243.3±9.0 °C(Predicted) |
| Dichte | 1.005±0.06 g/cm3(Predicted) |
| Lagerbedingungen | -20°C, sealed storage, away from moisture |
| pKa (Säurekonstante) | 13.46±0.18(Predicted) |
| InChI | InChI=1S/C3H8N2O/c1-2-3(6)5-4/h2,4H2,1H3,(H,5,6) |
| InChIKey | DXGIRFAFSFKYCF-UHFFFAOYSA-N |
| SMILES | C(NN)(=O)CC |
| CAS Datenbank | 5818-15-5(CAS DataBase Reference) |
Sicherheit & Vorschriften
| GHS-Einstufung | This chemical does not meet GHS hazard criteria for 1.7% (1 of 60) of reports.DangerH301 (96.7%): Toxic if swallowed [Danger Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P316, P302+P352, P304+P340, P305+P351+P338, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 60 reports by companies from 6 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 3 (96.7%) |
| Wassergefährdungsklasse (WGK) | 3 |
| UN-Transportnummer | UN 2811 6.1/PG 3 |
| RTECS-Nr. | UF4230000 |
| R-Sätze (R) | 25-36/37/38 |
| Gefahrensymbole | Xi,T |
| Sicherheitshinweise (S) | 26-45 |
| Gefahrenklasse | IRRITANTAcute Tox. 3 OralEye Irrit. 2Skin Irrit. 2STOT SE 3 |
| Lagerklasse | 6.1C - Combustible acute toxic Cat.3toxic compounds or compounds which causing chronic effects |
Anwendungen & Verwendung
Verwenden
Hydrazine propionate can be used as a pharmaceutical synthesis intermediate and can also be used to prepare a corrosion-resistant steel plate, including a steel plate and an anti-corrosion coating formed on the surface of the steel plate.