Identifikatoren & physikalische Daten
| CAS No. | 6036-95-9 |
|---|
| Summenformel | C17H24ClN3O |
|---|
| Durchschnittliche Molmasse | 321,8 g/mol |
|---|
| Monoisotopische Masse | 321,1607901 g/mol |
|---|
| SMILES | COc1ccc(CN(CCN(C)C)c2ccccn2)cc1.Cl |
|---|
| InChIKey | JZNHNILSWLPPKO-UHFFFAOYSA-N |
|---|
| PubChem CID | 80139 |
|---|
| EC No. | 227-920-7 |
|---|
| DTXSID | DTXSID1064089 |
|---|
Chemische & physikalische Eigenschaften
| Polarare Oberfläche (TPSA) | 28,6 |
|---|
| H-Brücken-Donoren | 1 |
|---|
| H-Brücken-Akzeptoren | 4 |
|---|
| Frei drehbare Bindungen | 7 |
|---|
| Schwere Atome | 22 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 277 |
|---|
Sicherheit & Vorschriften
| Regulatorische Informationen | 1,2-Ethanediamine, N-[(4-methoxyphenyl)methyl]-N',N'-dimethyl-N-2-pyridinyl-, monohydrochloride: Does not have an individual approval but may be used under an appropriate group standard |
|---|
