3-Acetylbenzonitril
3-CYANOACETOPHENONE · M-CYANOACETOPHENONE · 3-ACETYLBENZONITRILE · M-ACETYLBENZONITRILE · 3'-Cyanoacetophenone · 3-acethylbenzonitrile · Benzonitrile, 3-acetyl- · 3-Acetylbenzonitrile97%
Identifikatoren & physikalische Daten
| CAS No. | 6136-68-1 |
|---|---|
| Summenformel | C9H7NO |
| Durchschnittliche Molmasse | 145,16 g/mol |
| Monoisotopische Masse | 145,05276384 g/mol |
| SMILES | CC(=O)c1cccc(C#N)c1 |
| InChIKey | SBCFGFDAZCTSRH-UHFFFAOYSA-N |
| PubChem CID | 80222 |
| ChEMBL | CHEMBL4544662 |
| ChEBI | CHEBI:194596 |
| EC No. | 228-110-6 |
| DTXSID | DTXSID50210273 |
| Lokaler Name | 3-Acetylbenzonitril |
Chemische & physikalische Eigenschaften
| XLogP | 1,2 |
|---|---|
| Polarare Oberfläche (TPSA) | 40,9 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 2 |
| Frei drehbare Bindungen | 1 |
| Schwere Atome | 11 |
| Formalladung | 0 |
| Komplexität | 201 |
| SpringerMaterials Properties | 13C nuclear magnetic resonance spectrum |
| LogP (Verteilungskoeffizient) | 1.16 |
| Schmelzpunkt | 98-100 °C (lit.) |
| Siedepunkt | 120 °C (5 mmHg) |
| Dichte | 1.1555 (rough estimate) |
| Brechungsindex | 1.4500 (estimate) |
| Flammpunkt | 120°C/5mm |
| Lagerbedingungen | Sealed in dry,Room Temperature |
| Löslichkeit | 4g/lInsoluble in water. |
| Aggregatzustand | Powder |
| Farbe | Pale yellow-orange to brown |
| BRN | 2079629 |
| InChI | InChI=1S/C9H7NO/c1-7(11)9-4-2-3-8(5-9)6-10/h2-5H,1H3 |
| InChIKey | SBCFGFDAZCTSRH-UHFFFAOYSA-N |
| SMILES | C(#N)C1=CC=CC(C(C)=O)=C1 |
| CAS Datenbank | 6136-68-1(CAS DataBase Reference) |
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH302 (97.8%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P317, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 46 reports by companies from 6 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (97.8%) |
| Wassergefährdungsklasse (WGK) | 3 |
| TSCA-Inventar-Status | T |
| UN-Transportnummer | 3439 |
| Zollcode | 29269090 |
| R-Sätze (R) | 20/21/22-36/37/38 |
| Gefahrensymbole | Xn,Xi |
| hazard_note | Harmful/Irritant |
| Sicherheitshinweise (S) | 26-37/39 |
| Gefahrenklasse | 6.1Acute Tox. 4 OralEye Irrit. 2Skin Irrit. 2STOT SE 3 |
| Verpackungsgruppe | III |
| Lagerklasse | 11 - Combustible Solids |
Anwendungen & Verwendung
Beschreibung
3-Acetylbenzonitrile is a pharmaceutical intermediate compound. As its molecular structure contains both cyano (-CN) and acetyl (-COCH₃) functional groups, it is frequently used as a core building block for the synthesis of various bioactive heterocyclic compounds, such as sodium channel blockers. Furthermore, it can also be used in the preparation of OLED materials.
Verwenden
Preparation of (q2-2-Acetyl-4-cyanophenyl)tetra- carbonylmanganese by Reaction of 3-Acetylbenzonitrile with Benzylpentacarbonylmanganese. Four aromatic amidoximes were synthesized by reacting hydroxylamine with 1,3 -dicyanobenzene, 1,4- dicyanobenzene, 3-acetylbenzonitrile, and 4-acetylbenzonitrile. Darzens condensation of 3-acetylbenzonitrile provided aldehyde.