HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Bariumbis(4-anilinobenzolsulfonat)
4-Sulfodiphenylami · N-Phenylsulfanilic A · Diphenylaminesulfoni · BARIUM N-PHENYLSULFANILATE · Bariumanilinobenzolsulfonat · BARIUM DIPHENYLAMINESULFONATE · N-PhenylsulfonilicacidBasalt · 4-Sulfodiphenylaminebariumsalt
Identifikatoren & physikalische Daten
| CAS No. | 6211-24-1 |
|---|---|
| Summenformel | C24H20BaN2O6S2 |
| Durchschnittliche Molmasse | 633,9 g/mol |
| Monoisotopische Masse | 633,981526 g/mol |
| SMILES | O=S(=O)([O-])c1ccc(Nc2ccccc2)cc1.O=S(=O)([O-])c1ccc(Nc2ccccc2)cc1.[Ba+2] |
| InChIKey | IVCNVXFNTKXMCA-UHFFFAOYSA-L |
| PubChem CID | 80342 |
| EC No. | 228-278-0 |
| DTXSID | DTXSID4064135 |
| Lokaler Name | Bariumbis(4-anilinobenzolsulfonat) |
Chemische & physikalische Eigenschaften
| Polarare Oberfläche (TPSA) | 155 |
|---|---|
| H-Brücken-Donoren | 2 |
| H-Brücken-Akzeptoren | 8 |
| Frei drehbare Bindungen | 4 |
| Schwere Atome | 35 |
| Formalladung | 0 |
| Komplexität | 309 |
| Schmelzpunkt | 300 °C>300°C |
| Lagerbedingungen | Store at +5°C to +30°C. |
| Löslichkeit | Acetonitrile (Slightly), DMSO (Slightly, Heated)It is moderate soluble in water. |
| Aggregatzustand | Powder |
| Farbe | White |
| pH | 5.9 (10g/l, H2O, 20℃)(slurry) |
| Geruch | Odorless |
| Merck | 14,7313 |
| BRN | 3795146 |
| Stabilität | Stable. Incompatible with mineral acids, organic acids, strong oxidizing agents. |
| InChI | 1S/2C12H11NO3S.Ba/c2*14-17(15,16)12-8-6-11(7-9-12)13-10-4-2-1-3-5-10/h2*1-9,13H,(H,14,15,16)/q+2/p-2 |
| InChIKey | IVCNVXFNTKXMCA-UHFFFAOYSA-L |
| SMILES | [Ba+2].[S](=O)(=O)([O-])c3ccc(cc3)Nc4ccccc4.[S](=O)(=O)([O-])c1ccc(cc1)Nc2ccccc2 |
| CAS Datenbank | 6211-24-1(CAS DataBase Reference) |
| EPA chemische Informationen | Benzenesulfonic acid, 4-(phenylamino)-, barium salt (2:1) (6211-24-1) |
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH302 (97.9%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P270, P271, P301+P317, P304+P340, P317, P330, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 48 reports by companies from 5 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Regulatorische Informationen | Chemical: Benzenesulfonic acid, 4-(phenylamino)-, barium salt (2:1)Sulphanilic acid, N-phenyl-, barium salt (2:1): Does not have an individual approval but may be used under an appropriate group standard |
| Hazard Classes and Categories | Acute Tox. 4 (97.9%) |
| Protective Action Criteria (PAC) | 30 [mg/m3]330 [mg/m3]2000 [mg/m3] |
| Wassergefährdungsklasse (WGK) | 1 |
| TSCA-Inventar-Status | TSCA listed |
| UN-Transportnummer | 1564 |
| Zollcode | 2921 44 00 |
| R-Sätze (R) | 20/22 |
| Gefahrensymbole | Xn |
| Sicherheitshinweise (S) | 28 |
| Gefahrenklasse | 6.1Acute Tox. 4 InhalationAcute Tox. 4 Oral |
| Verpackungsgruppe | III |
| Lagerklasse | 11 - Combustible Solids |
Anwendungen & Verwendung
Verwenden
Indicator in oxidation-reduction titrations.