HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
N,N'-Dimethylethylendiamin
DMEDA · N,N'-Dimethylethylenediamine · SYM-DIMETHYLETHYLENEDIAMINE · DIMETHYLETHYLENEDIAMINE · DMEN · N,N'-dimethylethane-1,2-diamine · 1,2-Dimethylethylenediamine · methyl[2-(methylamino)ethyl]amine
Identifikatoren & physikalische Daten
| CAS No. | 110-70-3 |
|---|---|
| Summenformel | C4H12N2 |
| Durchschnittliche Molmasse | 88,15 g/mol |
| Monoisotopische Masse | 88,10004838 g/mol |
| SMILES | CNCCNC |
| InChIKey | KVKFRMCSXWQSNT-UHFFFAOYSA-N |
| PubChem CID | 8070 |
| EC No. | 203-793-3 |
| DTXSID | DTXSID4058730 |
| Lokaler Name | N,N'-Dimethylethylendiamin |
Chemische & physikalische Eigenschaften
| XLogP | -0,6 |
|---|---|
| Polarare Oberfläche (TPSA) | 24,1 |
| H-Brücken-Donoren | 2 |
| H-Brücken-Akzeptoren | 2 |
| Frei drehbare Bindungen | 3 |
| Schwere Atome | 6 |
| Formalladung | 0 |
| Komplexität | 17,5 |
| Stoffklassen | Nitrogen Compounds -> Amines, Aliphatic |
| SpringerMaterials Properties | Optical coefficient |
| Dampfdruck | 20.6 [mmHg] |
| Physical Description | Clear light yellow liquid[Sigma-Aldrich MSDS] |
| Schmelzpunkt | 1.63°C (estimate) |
| Siedepunkt | 119 °C(lit.) |
| Dichte | 0.819 g/mL at 20 °C(lit.) |
| Brechungsindex | n20/D 1.431(lit.) |
| Flammpunkt | 83 °F |
| Lagerbedingungen | Keep in dark place,Inert atmosphere,2-8°C |
| Löslichkeit | Miscible with chloroform and dichloromethane. |
| Aggregatzustand | Liquid |
| pKa (Säurekonstante) | 10.54±0.10(Predicted) |
| Wichte | 0.828 |
| Farbe | Clear colorless to slightly yellow |
| BRN | 878142 |
| InChI | 1S/C4H12N2/c1-5-3-4-6-2/h5-6H,3-4H2,1-2H3 |
| InChIKey | KVKFRMCSXWQSNT-UHFFFAOYSA-N |
| SMILES | CNCCNC |
| LogP (Verteilungskoeffizient) | -0.620 |
| CAS Datenbank | 110-70-3(CAS DataBase Reference) |
| NIST chemische Informationen | CH3NHCH2CH2NHCH3(110-70-3) |
| EPA chemische Informationen | 1,2-Ethanediamine, N,N'-dimethyl- (110-70-3) |
Sicherheit & Vorschriften
| GHS-Einstufung | DangerH226 (98.9%): Flammable liquid and vapor [Warning Flammable liquids]P210, P233, P240, P241, P242, P243, P260, P261, P264, P264+P265, P271, P280, P301+P330+P331, P302+P352, P302+P361+P354, P303+P361+P353, P304+P340, P305+P351+P338, P305+P354+P338, P316, P317, P319, P321, P332+P317, P337+P317, P362+P364, P363, P370+P378, P403+P233, P403+P235, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 89 reports by companies from 7 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Gefahrenübersicht | Intraperitoneal LD50 (mouse) = 200 mg/kg[RTECS] Causes burnsInhalation may cause corrosive injuries to upper respiratory tract and lungs[Sigma-Aldrich MSDS] |
| Hazard Classes and Categories | Flam. Liq. 3 (98.9%) |
| Unerwünschte Wirkungen | Dermatotoxin - Skin burns. |
| Wassergefährdungsklasse (WGK) | 3 |
| TSCA-Inventar-Status | TSCA listed |
| UN-Transportnummer | UN 2734 8/PG 2 |
| Zollcode | 29212900 |
| RTECS-Nr. | KV4250000 |
| R-Sätze (R) | 10-34-20/21/22 |
| Toxizität | mouse,LD50,intraperitoneal,200mg/kg (200mg/kg),European Journal of Medicinal Chemistry--Chimie Therapeutique. Vol. 17, Pg. 235, 1982. |
| Gefahrensymbole | C |
| Sicherheitshinweise (S) | 26-36/37/39-45-16 |
| Gefahrenklasse | 3Eye Dam. 1Flam. Liq. 3Skin Corr. 1B |
| Verpackungsgruppe | III |
| Lagerklasse | 3 - Flammable liquids |
Anwendungen & Verwendung
Verwenden
N,N'-Dimethylethylenediamine is used in DNA binding effect. It is used to enhance the adsorption of carbon dioxide. It acts as a ligand and form coordination complex such as dinitrato(N,N'-dimethyl-1,2-ethanediamine)copper(II) and dichloro(1,4-bis-(diphenyl phosphino)butane)-(1,2-ethylenediamine)ruthenium(II).