HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
2,3-Difluorophenol
Difluorophenol · 3-Difluorophenol · 2,3-DIFLUOROPHENOL · 2,3-Difluorophenole · PHENOL, 2,3-DIFLUORO- · 2,3-Difluorophenol>2,3-Difluorophenol 98% · 2,3-Difluorophenol,98+% · 2,3-Difluorophenol ,99%
Identifikatoren & physikalische Daten
| CAS No. | 6418-38-8 |
|---|---|
| Summenformel | C6H4F2O |
| Durchschnittliche Molmasse | 130,09 g/mol |
| Monoisotopische Masse | 130,02302119 g/mol |
| SMILES | Oc1cccc(F)c1F |
| InChIKey | RPEPGIOVXBBUMJ-UHFFFAOYSA-N |
| PubChem CID | 80879 |
| EC No. | 628-249-6 |
| DTXSID | DTXSID40214381 |
Chemische & physikalische Eigenschaften
| XLogP | 1,8 |
|---|---|
| Polarare Oberfläche (TPSA) | 20,2 |
| H-Brücken-Donoren | 1 |
| H-Brücken-Akzeptoren | 3 |
| Frei drehbare Bindungen | 0 |
| Schwere Atome | 9 |
| Formalladung | 0 |
| Komplexität | 97,1 |
| Schmelzpunkt | 39-42 °C (lit.) |
| Siedepunkt | 54 °C/25 mmHg (lit.) |
| Dichte | 1.2483 (estimate) |
| Flammpunkt | 134 °F |
| Lagerbedingungen | Inert atmosphere,2-8°C |
| pKa (Säurekonstante) | 7.71±0.10(Predicted) |
| Aggregatzustand | powder to lump to clear liquid |
| Farbe | White or Colorless to Almost white or Almost colorless |
| BRN | 2082265 |
| InChI | InChI=1S/C6H4F2O/c7-4-2-1-3-5(9)6(4)8/h1-3,9H |
| InChIKey | RPEPGIOVXBBUMJ-UHFFFAOYSA-N |
| SMILES | C1(O)=CC=CC(F)=C1F |
| CAS Datenbank | 6418-38-8(CAS DataBase Reference) |
Sicherheit & Vorschriften
| GHS-Einstufung | DangerH226 (83.3%): Flammable liquid and vapor [Warning Flammable liquids]P210, P233, P240, P241, P242, P243, P260, P261, P264, P264+P265, P270, P271, P280, P301+P317, P301+P330+P331, P302+P352, P302+P361+P354, P303+P361+P353, P304+P340, P305+P351+P338, P305+P354+P338, P316, P317, P319, P321, P330, P332+P317, P337+P317, P362+P364, P363, P370+P378, P403+P233, P403+P235, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 48 reports by companies from 8 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Flam. Liq. 3 (83.3%) |
| Wassergefährdungsklasse (WGK) | 3 |
| UN-Transportnummer | UN 1325 4.1/PG 2 |
| Zollcode | 29081000 |
| R-Sätze (R) | 11-22-36/37/38-34-20/21/22 |
| Gefahrensymbole | F,Xn,Xi,C |
| hazard_note | Irritant |
| Sicherheitshinweise (S) | 26-45-36/37/39-16 |
| Gefahrenklasse | 4.1Acute Tox. 4 OralEye Irrit. 2Flam. Liq. 3Skin Irrit. 2STOT SE 3 |
| Verpackungsgruppe | III |
| Lagerklasse | 3 - Flammable liquids |
Anwendungen & Verwendung
Verwenden
Intermediates of Liquid Crystals