HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Triisopropylphosphin
Tris(1-methylethyl)phosphine · insuresealbottle · Triisopropylphosphin · TRIISOPROPYLPHOSPHINE · TRI-I-PROPYLPHOSPHINE · Trisisopropylphosphine · PHOSPHORUS TRIISOPROPYL · Tri-i-propylphosphine,98%
Identifikatoren & physikalische Daten
| CAS No. | 6476-36-4 |
|---|---|
| Summenformel | C9H21P |
| Durchschnittliche Molmasse | 160,24 g/mol |
| Monoisotopische Masse | 160,1380873 g/mol |
| SMILES | CC(C)P(C(C)C)C(C)C |
| InChIKey | IGNTWNVBGLNYDV-UHFFFAOYSA-N |
| PubChem CID | 80969 |
| EC No. | 229-333-1 |
| DTXSID | DTXSID80215074 |
| Lokaler Name | Triisopropylphosphin |
Chemische & physikalische Eigenschaften
| XLogP | 2,3 |
|---|---|
| Polarare Oberfläche (TPSA) | 0 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 0 |
| Frei drehbare Bindungen | 3 |
| Schwere Atome | 10 |
| Formalladung | 0 |
| Komplexität | 65,7 |
| Siedepunkt | 81 °C22 mm Hg(lit.) |
| Dichte | 0.839 g/mL at 25 °C(lit.) |
| Brechungsindex | n20/D 1.466(lit.) |
| Flammpunkt | 1 °F |
| Lagerbedingungen | Flammables area |
| Löslichkeit | Soluble in alkanes. |
| Aggregatzustand | liquid |
| Farbe | colorless |
| BRN | 906732 |
| InChI | InChI=1S/C9H21P/c1-7(2)10(8(3)4)9(5)6/h7-9H,1-6H3 |
| InChIKey | IGNTWNVBGLNYDV-UHFFFAOYSA-N |
| SMILES | P(C(C)C)(C(C)C)C(C)C |
| CAS Datenbank | 6476-36-4(CAS DataBase Reference) |
Sicherheit & Vorschriften
| GHS-Einstufung | DangerH250 (97.8%): Catches fire spontaneously if exposed to air [Danger Pyrophoric liquids]P210, P222, P231, P233, P260, P264, P280, P301+P330+P331, P302+P335+P334, P302+P361+P354, P304+P340, P305+P354+P338, P316, P321, P363, P370+P378, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 45 reports by companies from 3 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Pyr. Liq. 1 (97.8%) |
| F | 10-13-23 |
| Wassergefährdungsklasse (WGK) | 3 |
| UN-Transportnummer | UN 2845 4.2/PG 1 |
| Zollcode | 29310099 |
| R-Sätze (R) | 17-34 |
| Gefahrensymbole | F,C |
| Sicherheitshinweise (S) | 17-26-36-45-36/37/39 |
| Gefahrenklasse | 4.2 |
| Verpackungsgruppe | I |
Anwendungen & Verwendung
Verwenden
Triisopropylphosphine is used as a ligand in organometallic chemistry. It is an important raw material and intermediate used in organic Synthesis, pharmaceuticals and agrochemicals. It is also used to produce Chlor(triisopropyl)phosphonium-dimesylamid at temperature of 40°C.