HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Dicyclohexylphenylphosphin
Dicyclohexyphenylphosphine · PHENYLPHOSPHINODICYCLOHEXANE · Dicyclohexyphenylphosphin · Dicyclohexylphenylphosphane · phenyldicyclohexylphosphine · dicyclohexylphenyl-phosphin · DICYCLOHEXYLPHENYLPHOSPHINE · Biscyclohexylphenylphosphine
Identifikatoren & physikalische Daten
| CAS No. | 6476-37-5 |
|---|---|
| Summenformel | C18H27P |
| Durchschnittliche Molmasse | 274,4 g/mol |
| Monoisotopische Masse | 274,18503786 g/mol |
| SMILES | c1ccc(P(C2CCCCC2)C2CCCCC2)cc1 |
| InChIKey | VPLLTGLLUHLIHA-UHFFFAOYSA-N |
| PubChem CID | 80970 |
| EC No. | 229-334-7 |
| DTXSID | DTXSID0073372 |
| Lokaler Name | Dicyclohexylphenylphosphin |
Chemische & physikalische Eigenschaften
| XLogP | 5,1 |
|---|---|
| Polarare Oberfläche (TPSA) | 0 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 0 |
| Frei drehbare Bindungen | 3 |
| Schwere Atome | 19 |
| Formalladung | 0 |
| Komplexität | 226 |
| Schmelzpunkt | 60-61 °C (lit.) |
| Siedepunkt | 391.8±11.0 °C(Predicted) |
| Lagerbedingungen | 2-8°C, protect from light, stored under nitrogen |
| Aggregatzustand | Crystalline Powder |
| Farbe | White to off-white |
| Löslichkeit | Insoluble in water. |
| InChI | InChI=1S/C18H27P/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1,4-5,10-11,17-18H,2-3,6-9,12-15H2 |
| InChIKey | VPLLTGLLUHLIHA-UHFFFAOYSA-N |
| SMILES | P(C1CCCCC1)(C1CCCCC1)C1=CC=CC=C1 |
| CAS Datenbank | 6476-37-5(CAS DataBase Reference) |
| NIST chemische Informationen | Dicyclohexylphenylphosphine(6476-37-5) |
| EPA chemische Informationen | Phosphine, dicyclohexylphenyl- (6476-37-5) |
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P264, P270, P301+P317, P330, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 45 reports by companies from 3 notifications to the ECHA C&L Inventory. |
|---|---|
| Regulatorische Informationen | PMN - indicates a commenced PMN (Pre-Manufacture Notices) substance. |
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
| Wassergefährdungsklasse (WGK) | 3 |
| TSCA-Inventar-Status | TSCA listed |
| Zollcode | 29310099 |
| RTECS-Nr. | SY9125000 |
| R-Sätze (R) | 22 |
| Gefahrensymbole | Xn |
| Sicherheitshinweise (S) | 36 |
| Lagerklasse | 11 - Combustible Solids |
| Gefahrenklasse | Acute Tox. 4 Oral |
Anwendungen & Verwendung
Verwenden
Dicyclohexylphenylphosphine is an organic phosphine compound, which can be used as a raw material for organic synthesis.