Identifikatoren & physikalische Daten
| CAS No. | 51289-10-2 |
|---|
| Summenformel | C12H8Cl2O |
|---|
| Durchschnittliche Molmasse | 239,09 g/mol |
|---|
| Monoisotopische Masse | 237,99522024 g/mol |
|---|
| SMILES | Clc1ccc(Oc2cccc(Cl)c2)cc1 |
|---|
| InChIKey | HPRGYUWRGCTBAV-UHFFFAOYSA-N |
|---|
| PubChem CID | 81283 |
|---|
| EC No. | 614-477-3 |
|---|
| DTXSID | DTXSID60871935 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 5,2 |
|---|
| Polarare Oberfläche (TPSA) | 9,2 |
|---|
| H-Brücken-Donoren | 0 |
|---|
| H-Brücken-Akzeptoren | 1 |
|---|
| Frei drehbare Bindungen | 2 |
|---|
| Schwere Atome | 15 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 190 |
|---|
| SpringerMaterials Properties | 13C nuclear magnetic resonance spectrum |
|---|
| LogP (Verteilungskoeffizient) | 5.13 |
|---|
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH302 (57.6%): Harmful if swallowed [Warning Acute toxicity, oral]P264, P270, P273, P280, P301+P317, P302+P352, P321, P330, P332+P317, P362+P364, P391, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 66 reports by companies from 3 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|
| Regulatorische Informationen | Status: Active Update: 20-09-2010 https://echa.europa.eu/registration-dossier/-/registered-dossier/1980 |
|---|
| Hazard Classes and Categories | Acute Tox. 4 (57.6%) |
|---|
