HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
2-Chlor-4-nitrobenzoylchlorid
2-Chlor-4-nitrobenzoylchlorid · 2-CHLORO-4-NITROBENZOYL CHLORIDE · 4-Nitro-2-chlorobenzoyl chloride · Benzoyl chloride, 2-chloro-4-nitro- · 2-Chloro-4-nitrobenzoyl Chloride >
Identifikatoren & physikalische Daten
| CAS No. | 7073-36-1 |
|---|---|
| Summenformel | C7H3Cl2NO3 |
| Durchschnittliche Molmasse | 220,01 g/mol |
| Monoisotopische Masse | 218,94899832 g/mol |
| SMILES | O=C(Cl)c1ccc([N+](=O)[O-])cc1Cl |
| InChIKey | KTHNITVDTYAHFF-UHFFFAOYSA-N |
| PubChem CID | 81522 |
| EC No. | 230-367-4 |
| DTXSID | DTXSID4064559 |
| Lokaler Name | 2-Chlor-4-nitrobenzoylchlorid |
Chemische & physikalische Eigenschaften
| XLogP | 3 |
|---|---|
| Polarare Oberfläche (TPSA) | 62,9 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 3 |
| Frei drehbare Bindungen | 1 |
| Schwere Atome | 13 |
| Formalladung | 0 |
| Komplexität | 228 |
| Schmelzpunkt | 26°C |
| Siedepunkt | 165°C 20mm |
| Dichte | 1.575±0.06 g/cm3(Predicted) |
| Brechungsindex | 1.5950 |
| Flammpunkt | 165°C/20mm |
| Lagerbedingungen | RT, stored under nitrogen |
| Löslichkeit | soluble in Toluene |
| Aggregatzustand | powder to lump to clear liquid |
| Farbe | White or Colorless to Yellow to Green |
| BRN | 519794 |
| CAS Datenbank | 7073-36-1(CAS DataBase Reference) |
| EPA chemische Informationen | Benzoyl chloride, 2-chloro-4-nitro- (7073-36-1) |
Sicherheit & Vorschriften
| GHS-Einstufung | DangerH290 (12.5%): May be corrosive to metals [Warning Corrosive to Metals]P234, P260, P264, P264+P265, P280, P301+P330+P331, P302+P361+P354, P304+P340, P305+P354+P338, P316, P317, P321, P363, P390, P405, P406, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 8 reports by companies from 4 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Met. Corr. 1 (12.5%) |
| TSCA-Inventar-Status | TSCA listed |
| UN-Transportnummer | 3265 |
| Zollcode | 2916.39.7900 |
| R-Sätze (R) | 34-41 |
| Gefahrensymbole | Xi |
| Sicherheitshinweise (S) | 26-36/37/39-45-39 |
| Gefahrenklasse | 8 |
| Verpackungsgruppe | II |
Anwendungen & Verwendung
Verwenden
2-Chloro-4-nitro-benzoyl chloride is a reactant in the synthesis of benzoxazole derivatives as interleukin-6 antagonists.