HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
3,3'-Dibromo-2,2'-bithiophene
3,3'-Dibromo-2,2'-dithiophene · Na ≥2TH-2Bra · -bithiophenyl · 5-Triiodo-β-Bi-p-anisidine · -Oxy-venetoclax · -Dicyanobiphenyl · -Diformylbiphenyl · -Dibromodiphenyl-d8
Identifikatoren & physikalische Daten
| CAS No. | 51751-44-1 |
|---|---|
| Summenformel | C8H4Br2S2 |
| Durchschnittliche Molmasse | 324,1 g/mol |
| Monoisotopische Masse | 321,81211633 g/mol |
| SMILES | Brc1ccsc1-c1sccc1Br |
| InChIKey | KBRZCEVRNLKHAZ-UHFFFAOYSA-N |
| PubChem CID | 819087 |
| EC No. | 663-413-0 |
| DTXSID | DTXSID50356044 |
Chemische & physikalische Eigenschaften
| XLogP | 4,4 |
|---|---|
| Polarare Oberfläche (TPSA) | 56,5 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 2 |
| Frei drehbare Bindungen | 1 |
| Schwere Atome | 12 |
| Formalladung | 0 |
| Komplexität | 147 |
| Schmelzpunkt | 103°C |
| Siedepunkt | 318.6±37.0 °C(Predicted) |
| Dichte | 1.951±0.06 g/cm3(Predicted) |
| Lagerbedingungen | Keep in dark place,Sealed in dry,Room Temperature |
| Löslichkeit | soluble in Toluene |
| Aggregatzustand | powder |
| Farbe | White to Yellow to Orange |
| InChI | InChI=1S/C8H4Br2S2/c9-5-1-3-11-7(5)8-6(10)2-4-12-8/h1-4H |
| InChIKey | KBRZCEVRNLKHAZ-UHFFFAOYSA-N |
| SMILES | C1(C2SC=CC=2Br)SC=CC=1Br |
Sicherheit & Vorschriften
| GHS-Einstufung | DangerH301 (100%): Toxic if swallowed [Danger Acute toxicity, oral]P264, P264+P265, P270, P280, P301+P316, P305+P354+P338, P317, P321, P330, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 41 reports by companies from 1 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 3 (100%) |
| Wassergefährdungsklasse (WGK) | 3 |
| UN-Transportnummer | 2811 |
| Zollcode | 29339900 |
| R-Sätze (R) | 25-41 |
| Gefahrensymbole | T |
| Sicherheitshinweise (S) | 26-39 |
| Gefahrenklasse | IRRITANTAcute Tox. 3 OralEye Dam. 1 |
| Verpackungsgruppe | Ⅲ |
| Lagerklasse | 6.1C - Combustible acute toxic Cat.3toxic compounds or compounds which causing chronic effects |
Anwendungen & Verwendung
Verwenden
suzuki reaction