Identifikatoren & physikalische Daten
| CAS No. | 7486-35-3 |
|---|
| Summenformel | C14H30Sn |
|---|
| Durchschnittliche Molmasse | 317,1 g/mol |
|---|
| Monoisotopische Masse | 318,13694566 g/mol |
|---|
| SMILES | C=[CH][Sn]([CH2]CCC)([CH2]CCC)[CH2]CCC |
|---|
| InChIKey | QIWRFOJWQSSRJZ-UHFFFAOYSA-N |
|---|
| PubChem CID | 81998 |
|---|
| EC No. | 231-291-4 |
|---|
| DTXSID | DTXSID40225836 |
|---|
Chemische & physikalische Eigenschaften
| Polarare Oberfläche (TPSA) | 0 |
|---|
| H-Brücken-Donoren | 0 |
|---|
| H-Brücken-Akzeptoren | 0 |
|---|
| Frei drehbare Bindungen | 10 |
|---|
| Schwere Atome | 15 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 130 |
|---|
Sicherheit & Vorschriften
| GHS-Einstufung | DangerH226 (82%): Flammable liquid and vapor [Warning Flammable liquids]P210, P233, P240, P241, P242, P243, P260, P264, P264+P265, P270, P273, P280, P301+P316, P302+P352, P303+P361+P353, P305+P351+P338, P317, P319, P321, P330, P332+P317, P337+P317, P362+P364, P370+P378, P391, P403+P235, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 50 reports by companies from 9 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|
| Hazard Classes and Categories | Flam. Liq. 3 (82%) |
|---|
