HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
t-Butyloxycarbonylaspartic acid alpha-benzyl ester
N-Boc-DL-aspartic acid 4-benzyl ester · (Tert-Butoxy)Carbonyl DL-Asp(OBzl)-OH · Aspartic acid, N-[(1,1-dimethylethoxy)carbonyl]-, 4-(phenylmethyl) ester
Identifikatoren & physikalische Daten
| CAS No. | 147291-69-8 |
|---|---|
| Summenformel | C16H21NO6 |
| Durchschnittliche Molmasse | 323,34 g/mol |
| Monoisotopische Masse | 323,13688739 g/mol |
| SMILES | CC(C)(C)OC(=O)NC(CC(=O)OCc1ccccc1)C(=O)O |
| InChIKey | SOHLZANWVLCPHK-UHFFFAOYSA-N |
| PubChem CID | 82036 |
| ChEMBL | CHEMBL1906597 |
Chemische & physikalische Eigenschaften
| XLogP | 1,9 |
|---|---|
| Polarare Oberfläche (TPSA) | 102 |
| H-Brücken-Donoren | 2 |
| H-Brücken-Akzeptoren | 6 |
| Frei drehbare Bindungen | 9 |
| Schwere Atome | 23 |
| Formalladung | 0 |
| Komplexität | 423 |
| Löslichkeit | >48.5 [ug/mL] (The mean of the results at pH 7.4) |
| Siedepunkt | 508.1±50.0 °C(Predicted) |
| Dichte | 1.219±0.06 g/cm3(Predicted) |
| pKa (Säurekonstante) | 3.65±0.23(Predicted) |