HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
2-Hydroxyphenethylalkohol
2-(2-Hydroxyethyl)phenol · 2-hydroxyphenylethanol · o-Hydroxyphenylethanol · 2-Hydroxybenzeneethanol · o-(2-Hydroxyethyl)phenol · o-Hydroxyphenethyl alcohol · 2-(o-Hydroxyphenyl)ethanol · 2-(2-Hydroxyphenyl)ethanol
Identifikatoren & physikalische Daten
| CAS No. | 7768-28-7 |
|---|---|
| Summenformel | C8H10O2 |
| Durchschnittliche Molmasse | 138,16 g/mol |
| Monoisotopische Masse | 138,06807956 g/mol |
| SMILES | OCCc1ccccc1O |
| InChIKey | ABFCOJLLBHXNOU-UHFFFAOYSA-N |
| PubChem CID | 82200 |
| ChEMBL | CHEMBL4075005 |
| ChEBI | CHEBI:64803 |
| EC No. | 231-863-3 |
| DTXSID | DTXSID90228312 |
| Lokaler Name | 2-Hydroxyphenethylalkohol |
Chemische & physikalische Eigenschaften
| XLogP | 1,2 |
|---|---|
| Polarare Oberfläche (TPSA) | 40,5 |
| H-Brücken-Donoren | 2 |
| H-Brücken-Akzeptoren | 2 |
| Frei drehbare Bindungen | 2 |
| Schwere Atome | 10 |
| Formalladung | 0 |
| Komplexität | 93,3 |
| Siedepunkt | 168-169 °C2 mm Hg(lit.) |
| Dichte | 1.159 g/mL at 25 °C(lit.) |
| Brechungsindex | n20/D 1.559(lit.) |
| Flammpunkt | >230 °F |
| Lagerbedingungen | Sealed in dry,Room Temperature |
| Löslichkeit | Chloroform, DMSO (Slightly), Methanol (Slightly) |
| pKa (Säurekonstante) | 10.24±0.30(Predicted) |
| Aggregatzustand | Viscous Liquid |
| Farbe | Clear yellow to yellow-brownish |
| Stabilität | Light Sensitive |
| InChI | InChI=1S/C8H10O2/c9-6-5-7-3-1-2-4-8(7)10/h1-4,9-10H,5-6H2 |
| InChIKey | ABFCOJLLBHXNOU-UHFFFAOYSA-N |
| SMILES | C1(CCO)=CC=CC=C1O |
| LogP (Verteilungskoeffizient) | 1.310 (est) |
Sicherheit & Vorschriften
| GHS-Einstufung | DangerH302 (97.7%): Harmful if swallowed [Warning Acute toxicity, oral]P264, P264+P265, P270, P280, P301+P317, P305+P354+P338, P317, P330, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 43 reports by companies from 3 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Regulatorische Informationen | Status: Active Update: 18-05-2021 https://echa.europa.eu/registration-dossier/-/registered-dossier/22844 |
| Hazard Classes and Categories | Acute Tox. 4 (97.7%) |
| Wassergefährdungsklasse (WGK) | 2 |
| Zollcode | 29072990 |
| R-Sätze (R) | 22-41-36/37/38 |
| Gefahrensymbole | Xn,Xi |
| Sicherheitshinweise (S) | 26-37/39-36 |
| Lagerklasse | 10 - Combustible liquids |
| Gefahrenklasse | Acute Tox. 4 OralEye Dam. 1 |
Anwendungen & Verwendung
Verwenden
2-Hydroxybenzeneethanol can be used to synthesize cyclic products and organoaluminim oligomers. Inelastic electron tunnelling spectra of 2-hydroxyphenethyl alcohol adsorbed on thin-film aluminium and magnesium oxide has been investigated.