HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
2,5-Dibrom-3-methylthiophen
RMA-163 · Einecs 236-147-4 · 2,5-Dibromo-3-methylthiophen · 2,5-Dibromo-3-methylthiophene · Thiophene, 2,5-dibromo-3-methyl- · 2,5-Dibromo-3-methylthiophene>2,5-DIBROMO-3-METHYLTHIOPHENE 98% · 2,5-DIBROMO-3-METHYLTHIOPHENE ISO 9001：2015 REACH
Identifikatoren & physikalische Daten
| CAS No. | 13191-36-1 |
|---|---|
| Summenformel | C5H4Br2S |
| Durchschnittliche Molmasse | 255,96 g/mol |
| Monoisotopische Masse | 253,84005 g/mol |
| SMILES | Cc1cc(Br)sc1Br |
| InChIKey | IHFXZROPBCBLLG-UHFFFAOYSA-N |
| PubChem CID | 83219 |
| EC No. | 236-147-4 |
| DTXSID | DTXSID40157249 |
| Lokaler Name | 2,5-Dibrom-3-methylthiophen |
Chemische & physikalische Eigenschaften
| XLogP | 4 |
|---|---|
| Polarare Oberfläche (TPSA) | 28,2 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 1 |
| Frei drehbare Bindungen | 0 |
| Schwere Atome | 8 |
| Formalladung | 0 |
| Komplexität | 86,5 |
| Schmelzpunkt | 130-132 °C |
| Siedepunkt | 226-230°C |
| Dichte | 1.974 g/mL at 25 °C |
| Brechungsindex | 1.6130 |
| Flammpunkt | 226-230°C |
| Lagerbedingungen | 2-8°C |
| Aggregatzustand | clear liquid |
| Farbe | Colorless to Light orange to Yellow |
| BRN | 108894 |
| InChI | InChI=1S/C5H4Br2S/c1-3-2-4(6)8-5(3)7/h2H,1H3 |
| InChIKey | IHFXZROPBCBLLG-UHFFFAOYSA-N |
| SMILES | C1(Br)SC(Br)=CC=1C |
Sicherheit & Vorschriften
| GHS-Einstufung | DangerH302 (88.6%): Harmful if swallowed [Warning Acute toxicity, oral]P264, P264+P265, P270, P280, P301+P317, P302+P352, P305+P351+P338, P305+P354+P338, P317, P321, P330, P332+P317, P337+P317, P362+P364, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 44 reports by companies from 4 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (88.6%) |
| Wassergefährdungsklasse (WGK) | 3 |
| UN-Transportnummer | UN 2810 6.1 / PGIII |
| Zollcode | 2930.90.2900 |
| R-Sätze (R) | 36/38-41-38-22 |
| Gefahrensymbole | Xn |
| Sicherheitshinweise (S) | 26-36/37/39-39 |
| Lagerklasse | 6.1C - Combustible acute toxic Cat.3toxic compounds or compounds which causing chronic effects |
| Gefahrenklasse | Acute Tox. 4 OralEye Dam. 1Skin Irrit. 2 |
Anwendungen & Verwendung
Verwenden
2,5-Dibromo-3-methylthiophene, is a building block used in chemical synthesis of various compounds.