HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
4-Acetamido-2,5-dimethoxybenzolsulfonylchlorid
Einecs 236-279-2 · 4-Chlorosulfonyl-2,5-dimethoxyacetanilide · 4-acetamido-2,5-dimethoxybenzenesulphonyl chloride · 4-Acetylamino-2,5-dimethoxybenzenesulfonyl chloride · Benzenesulfonyl chloride, 4-(acetylamino)-2,5-dimethoxy-
Identifikatoren & physikalische Daten
| CAS No. | 13279-58-8 |
|---|---|
| Summenformel | C10H12ClNO5S |
| Durchschnittliche Molmasse | 293,72 g/mol |
| Monoisotopische Masse | 293,0124714 g/mol |
| SMILES | COc1cc(S(=O)(=O)Cl)c(OC)cc1NC(C)=O |
| InChIKey | QMJIZLZFBGRSAS-UHFFFAOYSA-N |
| PubChem CID | 83296 |
| EC No. | 236-279-2 |
| DTXSID | DTXSID1065394 |
| Lokaler Name | 4-Acetamido-2,5-dimethoxybenzolsulfonylchlorid |
Chemische & physikalische Eigenschaften
| XLogP | 1,1 |
|---|---|
| Polarare Oberfläche (TPSA) | 90,1 |
| H-Brücken-Donoren | 1 |
| H-Brücken-Akzeptoren | 5 |
| Frei drehbare Bindungen | 4 |
| Schwere Atome | 18 |
| Formalladung | 0 |
| Komplexität | 394 |
| Schmelzpunkt | 160-163 °C |
| Siedepunkt | 470.3±45.0 °C(Predicted) |
| Dichte | 1.417±0.06 g/cm3(Predicted) |
| pKa (Säurekonstante) | 12.66±0.70(Predicted) |
| EPA chemische Informationen | Benzenesulfonyl chloride, 4-(acetylamino)-2,5-dimethoxy- (13279-58-8) |
Sicherheit & Vorschriften
| TSCA-Inventar-Status | TSCA listed |
|---|
Anwendungen & Verwendung
Verwenden
Synthetic reagent. Previously employed in literature as a component for the synthesis of both azo-dyes and pest control agents.