HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Dichlordiethylgerman
ermanium dichL · germanium dichL · DICHLORODIETHYLGERMANE · DIETHYLDICHLOROGERMANE · ichloro(diethyl)germane · Diethyldichlorogermanium · Germane, dichlorodiethyl- · Dichlorodiethylgermane,97%
Identifikatoren & physikalische Daten
| CAS No. | 13314-52-8 |
|---|---|
| Summenformel | C4H10Cl2Ge |
| Durchschnittliche Molmasse | 201,66 g/mol |
| Monoisotopische Masse | 201,93713348 g/mol |
| SMILES | C[CH2][Ge]([Cl])([Cl])[CH2]C |
| InChIKey | BWUPRNSPZFPYEK-UHFFFAOYSA-N |
| PubChem CID | 83334 |
| EC No. | 236-344-5 |
| DTXSID | DTXSID90157976 |
| Lokaler Name | Dichlordiethylgerman |
Chemische & physikalische Eigenschaften
| Polarare Oberfläche (TPSA) | 0 |
|---|---|
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 0 |
| Frei drehbare Bindungen | 2 |
| Schwere Atome | 7 |
| Formalladung | 0 |
| Komplexität | 47,7 |
| Schmelzpunkt | -39°C |
| Siedepunkt | 175 °C |
| Dichte | 1.372 g/mL at 25 °C (lit.) |
| Brechungsindex | n20/D 1.471(lit.) |
| Flammpunkt | 145 °F |
| Aggregatzustand | Liquid |
| Wichte | 1.372 |
| Farbe | Colorless |
| Löslichkeit | Decomposes in water and NH<sub>3</sub>. Soluble in organic solvents |
| InChI | InChI=1S/C4H10Cl2Ge/c1-3-7(5,6)4-2/h3-4H2,1-2H3 |
| InChIKey | BWUPRNSPZFPYEK-UHFFFAOYSA-N |
| SMILES | [Ge](Cl)(Cl)(CC)CC |
| CAS Datenbank | 13314-52-8(CAS DataBase Reference) |
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P317, P319, P321, P330, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 44 reports by companies from 4 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
| Wassergefährdungsklasse (WGK) | 3 |
| TSCA-Inventar-Status | No |
| UN-Transportnummer | UN 3265 8/PG 2 |
| R-Sätze (R) | 10-20/21/22-36/37 |
| Gefahrensymbole | Xn |
| Sicherheitshinweise (S) | 16-26-36 |
| Gefahrenklasse | 8Acute Tox. 4 OralEye Irrit. 2STOT SE 3 |
| Verpackungsgruppe | II |
| Lagerklasse | 10 - Combustible liquids |
Anwendungen & Verwendung
Verwenden
As an intermediate