HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
2-Aminoanthraquinone
AAQ · 2-aminoanthracene-9,10-dione · 2-AAQ · 80.0%(LC) · NCI-C01876 · AKOS NCG-0048 · 10-Anthracenedion · Aminoanthraquinone
Identifikatoren & physikalische Daten
| CAS No. | 117-79-3 |
|---|---|
| Summenformel | C14H9NO2 |
| Durchschnittliche Molmasse | 223,23 g/mol |
| Monoisotopische Masse | 223,06332853 g/mol |
| SMILES | Nc1ccc2c(c1)C(=O)c1ccccc1C2=O |
| InChIKey | XOGPDSATLSAZEK-UHFFFAOYSA-N |
| PubChem CID | 8341 |
| ChEMBL | CHEMBL84685 |
| ChEBI | CHEBI:34258 |
| EC No. | 204-208-4 |
| DTXSID | DTXSID6020068 |
Chemische & physikalische Eigenschaften
| XLogP | 2,7 |
|---|---|
| Polarare Oberfläche (TPSA) | 60,2 |
| H-Brücken-Donoren | 1 |
| H-Brücken-Akzeptoren | 3 |
| Frei drehbare Bindungen | 0 |
| Schwere Atome | 17 |
| Formalladung | 0 |
| Komplexität | 352 |
| Schmelzpunkt | 292-295 °C (dec.)(lit.) |
| Siedepunkt | 364.52°C (rough estimate) |
| Dichte | 1.1814 (rough estimate) |
| Brechungsindex | 1.4700 (estimate) |
| Flammpunkt | 283°C |
| Lagerbedingungen | 2-8°C, protect from light |
| Löslichkeit | ethanol: soluble(lit.)163ug/L(25 ºC) |
| pKa (Säurekonstante) | 0.97±0.20(Predicted) |
| Aggregatzustand | solid |
| Farbe | Brown |
| BRN | 745903 |
| Henry-Konstante | 1.1×105 mol/(m3Pa) at 25℃, Duchowicz et al. (2020) |
| Stabilität | Stable. Incompatible with strong oxidizing agents. |
| InChI | 1S/C14H9NO2/c15-8-5-6-11-12(7-8)14(17)10-4-2-1-3-9(10)13(11)16/h1-7H,15H2 |
| InChIKey | XOGPDSATLSAZEK-UHFFFAOYSA-N |
| SMILES | Nc1ccc2C(=O)c3ccccc3C(=O)c2c1 |
| CAS Datenbank | 117-79-3(CAS DataBase Reference) |
| EPA chemische Informationen | 2-Aminoanthraquinone (117-79-3) |
Sicherheit & Vorschriften
| Wassergefährdungsklasse (WGK) | 3 |
|---|---|
| TSCA-Inventar-Status | TSCA listed |
| Zollcode | 2922290090 |
| RTECS-Nr. | CB5120000 |
| R-Sätze (R) | 40 |
| Gefahrensymbole | Xn |
| Sicherheitshinweise (S) | 36/37/39 |
| Verpackungsgruppe | II |
| Lagerklasse | 11 - Combustible Solids |
| Gefahrstoffdaten | 117-79-3(Hazardous Substances Data) |
| Gefahrenklasse | Carc. 2 |
Anwendungen & Verwendung
Verwenden
2-Aminoanthraquinone was used in fabrication of high performance electrode of supercapacitor based on chemically modified graphene hydrogel. It was used in preparation of ordered assemblies of organic and biological molecules on gold(111) surfaces.