HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
1-Naphthalenemethanamine
naphthalen-1-ylMethanaMine · 1-NAPHTHYLMETHYLAMINE · NaphthylMethylaMine · (Naphth-1-yl)methylamine · 1-AMINOMETHYLNAPHTHALENE · C-NAPHTHALEN-1-YL-METHYLAMINE · enemethyL · MFCD15147375
Identifikatoren & physikalische Daten
| CAS No. | 118-31-0 |
|---|---|
| Summenformel | C11H11N |
| Durchschnittliche Molmasse | 157,21 g/mol |
| Monoisotopische Masse | 157,08914936 g/mol |
| SMILES | NCc1cccc2ccccc12 |
| InChIKey | NVSYANRBXPURRQ-UHFFFAOYSA-N |
| PubChem CID | 8355 |
| ChEMBL | CHEMBL128633 |
| EC No. | 204-244-0 |
| DTXSID | DTXSID4059469 |
Chemische & physikalische Eigenschaften
| XLogP | 2,1 |
|---|---|
| Polarare Oberfläche (TPSA) | 26 |
| H-Brücken-Donoren | 1 |
| H-Brücken-Akzeptoren | 1 |
| Frei drehbare Bindungen | 1 |
| Schwere Atome | 12 |
| Formalladung | 0 |
| Komplexität | 144 |
| Schmelzpunkt | 262-269 °C |
| Siedepunkt | 290-293 °C (lit.) |
| Dichte | 1.073 g/mL at 25 °C (lit.) |
| Brechungsindex | n20/D 1.643(lit.) |
| Flammpunkt | >230 °F |
| Lagerbedingungen | Keep in dark place,Inert atmosphere,2-8°C |
| Löslichkeit | Miscible with ethanol, ether and carbon disulfide. |
| Aggregatzustand | Liquid |
| pKa (Säurekonstante) | 9.06±0.30(Predicted) |
| Farbe | Clear light yellow to yellow |
| BRN | 2206459 |
| InChI | InChI=1S/C11H11N/c12-8-10-6-3-5-9-4-1-2-7-11(9)10/h1-7H,8,12H2 |
| InChIKey | NVSYANRBXPURRQ-UHFFFAOYSA-N |
| SMILES | C1(CN)=C2C(C=CC=C2)=CC=C1 |
| CAS Datenbank | 118-31-0(CAS DataBase Reference) |
| EPA chemische Informationen | 1-Naphthalenemethanamine (118-31-0) |
Sicherheit & Vorschriften
| F | 10-34 |
|---|---|
| Wassergefährdungsklasse (WGK) | 3 |
| TSCA-Inventar-Status | TSCA listed |
| UN-Transportnummer | 2735 |
| Zollcode | 29214990 |
| R-Sätze (R) | 36/37/38 |
| Gefahrensymbole | Xi |
| Sicherheitshinweise (S) | 26-36/37/39 |
| Gefahrenklasse | 8Eye Irrit. 2Skin Irrit. 2STOT SE 3 |
| Verpackungsgruppe | III |
| Lagerklasse | 10 - Combustible liquids |
Anwendungen & Verwendung
Verwenden
1-Naphthalenemethylamine is used to increase the induced circular dichroism (ICD) magnitude exhibited by poly[(4-carboxyphenyl)acetylene]. Further, it reacts with monomethoxypoly(ethylene glycol) succinimido carbonate to prepare carbamate.