HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Tris(1,1-dimethylethyl)phosphin
P(t-Bu)3 · TTBP · TRI-T-BUTYLPHOSPHINE · Tri-tert-butyL · Butylphosphine · ri-tert-butylphosphine · Tris(tert-butyl)phosphine · Uncle Ding Jilin
Identifikatoren & physikalische Daten
| CAS No. | 13716-12-6 |
|---|---|
| Summenformel | C12H27P |
| Durchschnittliche Molmasse | 202,32 g/mol |
| Monoisotopische Masse | 202,18503749 g/mol |
| SMILES | CC(C)(C)P(C(C)(C)C)C(C)(C)C |
| InChIKey | BWHDROKFUHTORW-UHFFFAOYSA-N |
| PubChem CID | 83681 |
| EC No. | 237-266-4 |
| DTXSID | DTXSID80160090 |
| Lokaler Name | Tris(1,1-dimethylethyl)phosphin |
Chemische & physikalische Eigenschaften
| XLogP | 2,9 |
|---|---|
| Polarare Oberfläche (TPSA) | 0 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 0 |
| Frei drehbare Bindungen | 3 |
| Schwere Atome | 13 |
| Formalladung | 0 |
| Komplexität | 128 |
| SpringerMaterials Properties | Schoenflies notation |
| Schmelzpunkt | 30-35 °C(lit.) |
| Siedepunkt | 102-103 °C13 mm Hg(lit.) |
| Dichte | 0.861 g/mL at 25 °C |
| Flammpunkt | 1 °F |
| Lagerbedingungen | Flammables area |
| Aggregatzustand | solid |
| Wichte | 0.68 |
| Löslichkeit | insoluble |
| BRN | 1738613 |
| InChI | InChI=1S/C12H27P/c1-10(2,3)13(11(4,5)6)12(7,8)9/h1-9H3 |
| InChIKey | BWHDROKFUHTORW-UHFFFAOYSA-N |
| SMILES | P(C(C)(C)C)(C(C)(C)C)C(C)(C)C |
| CAS Datenbank | 13716-12-6(CAS DataBase Reference) |
| NIST chemische Informationen | Tri-tert-butylphosphine(13716-12-6) |
Sicherheit & Vorschriften
| GHS-Einstufung | DangerH250 (98.2%): Catches fire spontaneously if exposed to air [Danger Pyrophoric liquids]P210, P222, P231, P233, P260, P264, P264+P265, P280, P301+P330+P331, P302+P335+P334, P302+P361+P354, P304+P340, P305+P354+P338, P316, P317, P321, P363, P370+P378, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 57 reports by companies from 6 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Pyr. Liq. 1 (98.2%) |
| F | 10-19-23 |
| Wassergefährdungsklasse (WGK) | 3 |
| UN-Transportnummer | UN 2846 4.2/PG 1 |
| Zollcode | 29319090 |
| R-Sätze (R) | 17-34-67-65-63-48/20-11 |
| Gefahrensymbole | F,C |
| Sicherheitshinweise (S) | 26-45-62-36/37/39-25-43-27-16 |
| Gefahrenklasse | 4.2Carc. 2Eye Dam. 1Flam. Liq. 2Pyr. Liq. 1Skin Corr. 1BSTOT SE 3 |
| Verpackungsgruppe | I |
| Lagerklasse | 4.2 - Pyrophoric and self-heating hazardous materials |
Anwendungen & Verwendung
Verwenden
Tri-tert-butylphosphine is used primarily in the preparation of mono- and bidentate phosphine ligands in metal complexes for catalytic chiral asymmetric hydrogenations and other asymmetric reactions as well as transition metal coupling reactions. This reagent is also used in the preparation of other phosphines in catalytic polymerization reactions.