2,3,5,6,8,9,11,12-Octahydro-1,4,7,10,13-benzopentaoxacyclopentadecin
2,3,5,6,8,9,11,12-octahydrobenzo[b][1,4,7,10,13]pentaoxacyclopentadecine · denzo15c5 · benzo15c5 · BENZO-15-CROWN-5 · Benzene-15-Crown-5 · Monobenzo-15-crown-5 · Benzo-15-crown-5,99% · Benzo-15-crown-5,97%
Identifikatoren & physikalische Daten
| CAS No. | 14098-44-3 |
|---|---|
| Summenformel | C14H20O5 |
| Durchschnittliche Molmasse | 268,3 g/mol |
| Monoisotopische Masse | 268,13107374 g/mol |
| SMILES | c1ccc2c(c1)OCCOCCOCCOCCO2 |
| InChIKey | FNEPSTUXZLEUCK-UHFFFAOYSA-N |
| PubChem CID | 84197 |
| ChEMBL | CHEMBL158353 |
| ChEBI | CHEBI:37444 |
| EC No. | 237-947-6 |
| DTXSID | DTXSID70161511 |
| Lokaler Name | 2,3,5,6,8,9,11,12-Octahydro-1,4,7,10,13-benzopentaoxacyclopentadecin |
Chemische & physikalische Eigenschaften
| XLogP | 0,9 |
|---|---|
| Polarare Oberfläche (TPSA) | 46,2 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 5 |
| Frei drehbare Bindungen | 0 |
| Schwere Atome | 19 |
| Formalladung | 0 |
| Komplexität | 202 |
| SpringerMaterials Properties | Fusion temperature |
| LogP (Verteilungskoeffizient) | 0.91 |
| Schmelzpunkt | 78-80 °C (lit.) |
| Siedepunkt | 371.47°C (rough estimate) |
| Dichte | 1.1846 (rough estimate) |
| Brechungsindex | 1.4825 (estimate) |
| Lagerbedingungen | Inert atmosphere,Room Temperature |
| Aggregatzustand | Powder or Flakes |
| Farbe | Almost white to light gray |
| Löslichkeit | partially soluble |
| BRN | 1624106 |
| InChI | InChI=1S/C14H20O5/c1-2-4-14-13(3-1)18-11-9-16-7-5-15-6-8-17-10-12-19-14/h1-4H,5-12H2 |
| InChIKey | DSFHXKRFDFROER-UHFFFAOYSA-N |
| SMILES | O1C2=CC=CC=C2OCCOCCOCCOCC1 |
| CAS Datenbank | 14098-44-3(CAS DataBase Reference) |
| NIST chemische Informationen | Bis(1,4,7,10,13-benzopentaoxacyclopentadecin, 2,3,5,6,8,9,11,12-octahydro-)(14098-44-3) |
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 7 reports by companies from 4 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Regulatorische Informationen | 1,4,7,10,13-Benzopentaoxacyclopentadecin, 2,3,5,6,8,9,11,12-octahydro-: Does not have an individual approval but may be used under an appropriate group standard |
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| F | 3-10 |
| Wassergefährdungsklasse (WGK) | 3 |
| Zollcode | 29329995 |
| RTECS-Nr. | DI5400000 |
| R-Sätze (R) | 36/37/38 |
| Gefahrensymbole | Xi |
| hazard_note | Irritant |
| Sicherheitshinweise (S) | 22-24/25-36-26 |
| Lagerklasse | 11 - Combustible Solids |
Anwendungen & Verwendung
Verwenden
Benzo-15-crown-5 is used in synthetic chemistry. It plays a major role and involved in complexation through ether oxygen. It is used in phase-transfer catalyst system. It is involved in 'Host-Guest' chemistry to identify the move of essential elements in the body. It can play the part of very complicated biological reactions such as enzyme functions, which finds application in the development of new pharmaceuticals.
Herstellung & Synthese
synthetische
synthesis of Benzo-15-crown-5: benzo-15-crown-5 can be produced using Williamson synthesis reaction, featured by interaction between catechol (orto-dihydroxybenzene) and tetraethylene glycol dichloride (1,10-dichloro-3,6,9-trioxadecane) over sodium hydroxide in the n-butanol media (30-h inertatmosphere boiling). The yield of benzo-15-crown-5 produced by this method is 62%, with the basic substance's mass fraction of 95%.Production of Macrocyclic Polyether Benzo-15-Crown-5 and its Functional Derivatives