HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
p-(Chlordiphenylmethyl)anisol
MMT-CL · MMTRCL · (chloro(4-Methoxyphenyl)Methylene)dibenzene · 4-METHOXYTRITYL CHLORIDE · 4-METHOXYTRIPHENYLMETHYL CHLORIDE · P-METHOXYTRITYL CHLORIDE · Monomethoxytrityl Chloride · 4-MethoxytrityL
Identifikatoren & physikalische Daten
| CAS No. | 14470-28-1 |
|---|---|
| Summenformel | C20H17ClO |
| Durchschnittliche Molmasse | 308,8 g/mol |
| Monoisotopische Masse | 308,09679284 g/mol |
| SMILES | COc1ccc(C(Cl)(c2ccccc2)c2ccccc2)cc1 |
| InChIKey | OBOHMJWDFPBPKD-UHFFFAOYSA-N |
| PubChem CID | 84462 |
| EC No. | 238-463-8 |
| DTXSID | DTXSID90162787 |
| Lokaler Name | p-(Chlordiphenylmethyl)anisol |
Chemische & physikalische Eigenschaften
| XLogP | 5,5 |
|---|---|
| Polarare Oberfläche (TPSA) | 9,2 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 1 |
| Frei drehbare Bindungen | 4 |
| Schwere Atome | 22 |
| Formalladung | 0 |
| Komplexität | 305 |
| Schmelzpunkt | 122-124 °C(lit.) |
| Siedepunkt | 423.55°C (rough estimate) |
| Dichte | 1.0704 (rough estimate) |
| Brechungsindex | 1.4530 (estimate) |
| Lagerbedingungen | 2-8°C |
| Löslichkeit | Soluble in toluene. |
| Aggregatzustand | crystalline |
| Farbe | off-white to pink |
| BRN | 798425 |
| InChI | InChI=1S/C20H17ClO/c1-22-19-14-12-18(13-15-19)20(21,16-8-4-2-5-9-16)17-10-6-3-7-11-17/h2-15H,1H3 |
| InChIKey | OBOHMJWDFPBPKD-UHFFFAOYSA-N |
| SMILES | C1(C(Cl)(C2=CC=CC=C2)C2=CC=CC=C2)=CC=C(OC)C=C1 |
| CAS Datenbank | 14470-28-1(CAS DataBase Reference) |
| NIST chemische Informationen | P-anisylchlorodiphenylmethane(14470-28-1) |
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH315 (97.8%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 46 reports by companies from 6 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (97.8%) |
| F | 10-21 |
| Wassergefährdungsklasse (WGK) | 3 |
| Zollcode | 29093090 |
| R-Sätze (R) | 36/37/38-34 |
| Gefahrensymbole | Xi,C |
| Sicherheitshinweise (S) | 26-36-45-36/37/39 |
| Lagerklasse | 11 - Combustible Solids |
Anwendungen & Verwendung
Beschreibung
4-Methoxytriphenylmethyl chloride is an important organic intermediate compound, which can be used as an organic synthetic material or reaction reagent for the preparation of a group of cyclic polypeptide compounds, phosphoramidite nucleoside derivatives, nanomaterials and their antiviral drugs.
Verwenden
4-Methoxytriphenylmethyl chloride is used in the synthesis of N-sulfonyl imines.