HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Bis(trimethylsilyl)acetylen
BTMSA · 1,2-Bis(trimethylsilyl)ethyne · BSTMA · Bis(trimethylsilyl)ethyne · 1,2-BIS-TRIMETHYLSILANYL-ETHYNE · DK079 · DK080 · ICLA-002
Identifikatoren & physikalische Daten
| CAS No. | 14630-40-1 |
|---|---|
| Summenformel | C8H18Si2 |
| Durchschnittliche Molmasse | 170,4 g/mol |
| Monoisotopische Masse | 170,09470364 g/mol |
| SMILES | C[Si](C)(C)C#C[Si](C)(C)C |
| InChIKey | ZDWYFWIBTZJGOR-UHFFFAOYSA-N |
| PubChem CID | 84564 |
| EC No. | 238-671-9 |
| DTXSID | DTXSID3065798 |
| Lokaler Name | Bis(trimethylsilyl)acetylen |
Chemische & physikalische Eigenschaften
| Polarare Oberfläche (TPSA) | 0 |
|---|---|
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 0 |
| Frei drehbare Bindungen | 2 |
| Schwere Atome | 10 |
| Formalladung | 0 |
| Komplexität | 149 |
| Stoffklassen | Metals -> Metalloid Compounds (Silicon) |
| SpringerMaterials Properties | 29Si nuclear magnetic resonance spectrum |
| Physical Description | Clear colorless liquidmp = 21-24 deg C[Sigma-Aldrich MSDS] |
| Schmelzpunkt | 21-24 °C(lit.) |
| Siedepunkt | 136-137 °C(lit.) |
| Dichte | 0.752 g/mL at 25 °C(lit.) |
| Brechungsindex | n20/D 1.427(lit.) |
| Flammpunkt | 29 °C |
| Lagerbedingungen | 2-8°C |
| Löslichkeit | soluble in Chloroform, MethanolMAY DECOMPOSE |
| Aggregatzustand | liquid |
| Wichte | 0.770 |
| Farbe | colorless |
| BRN | 906870 |
| InChI | 1S/C8H18Si2/c1-9(2,3)7-8-10(4,5)6/h1-6H3 |
| InChIKey | ZDWYFWIBTZJGOR-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C#C[Si](C)(C)C |
| CAS Datenbank | 14630-40-1(CAS DataBase Reference) |
| NIST chemische Informationen | Silane, 1,2-ethynediylbis[trimethyl-(14630-40-1) |
| EPA chemische Informationen | Silane, 1,2-ethynediylbis[trimethyl- (14630-40-1) |
Sicherheit & Vorschriften
| GHS-Einstufung | DangerH225 (83.7%): Highly Flammable liquid and vapor [Danger Flammable liquids]P210, P233, P240, P241, P242, P243, P261, P264, P264+P265, P271, P280, P302+P352, P303+P361+P353, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P370+P378, P403+P233, P403+P235, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 49 reports by companies from 9 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Regulatorische Informationen | Bis(trimethylsilyl)acetylene: Does not have an individual approval but may be used under an appropriate group standard |
| Gefahrenübersicht | A skin and strong eye irritant[Sigma-Aldrich MSDS] See Trimethylsilylacetylene and 1-Phenyl-2-(trimethylsilyl)acetylene. |
| Hazard Classes and Categories | Flam. Liq. 2 (83.7%) |
| F | 10 |
| Wassergefährdungsklasse (WGK) | 3 |
| TSCA-Inventar-Status | TSCA listed |
| UN-Transportnummer | UN 1993 3/PG 2 |
| Zollcode | 29310095 |
| R-Sätze (R) | 11-36/37/38-10 |
| Gefahrensymbole | F,Xi |
| Sicherheitshinweise (S) | 16-26-36 |
| Gefahrenklasse | 3Eye Irrit. 2Flam. Liq. 2Skin Irrit. 2STOT SE 3 |
| Verpackungsgruppe | III |
| Lagerklasse | 3 - Flammable liquids |
Anwendungen & Verwendung
Verwenden
BTMSA is used as starting reagent in the synthesis of functionalized 4-R-1,2-bis(trimethylsilyl)benzenes. It is also used in the synthesis of (+)-brasilenyne2 and (β-diketanato)Ag(BTMSA). Bis(trimethylsilyl)acetylene is a ligand that binds to a central metal ion (e.g. Titanium) to create a coordination complex. One of its complexes, Permethyltitanocene-bis(trimethylsilyl)acetylene, is a catalyst for the head-to-tail dimerization of 1-alkynes (e.g. 3-Penten-1-yne [P227430]).