HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
L-Galaktose
L-GALACTOPYRANOSE · L-Galactal · (2S,3R,4R,5S)-2,3,4,5,6-pentahydroxyhexanal · L-Gal · L-Galactose · (2S,3R,4R,5S) · α-L-galactose · Galactose, L-
Identifikatoren & physikalische Daten
| CAS No. | 15572-79-9 |
|---|---|
| Summenformel | C6H12O6 |
| Durchschnittliche Molmasse | 180,16 g/mol |
| Monoisotopische Masse | 180,0633881 g/mol |
| SMILES | O=C[C@@H](O)[C@H](O)[C@H](O)[C@@H](O)CO |
| InChIKey | GZCGUPFRVQAUEE-DPYQTVNSSA-N |
| PubChem CID | 84996 |
| ChEBI | CHEBI:37617 |
| EC No. | 239-630-8 |
| Lokaler Name | L-Galaktose |
Chemische & physikalische Eigenschaften
| XLogP | -2,9 |
|---|---|
| Polarare Oberfläche (TPSA) | 118 |
| H-Brücken-Donoren | 5 |
| H-Brücken-Akzeptoren | 6 |
| Frei drehbare Bindungen | 5 |
| Schwere Atome | 12 |
| Formalladung | 0 |
| Komplexität | 138 |
| Schmelzpunkt | 166-167 °C |
| Siedepunkt | 232.96°C (rough estimate) |
| Dichte | 1.2805 (rough estimate) |
| Brechungsindex | -79 ° (C=1, H2O) |
| Lagerbedingungen | Room Temperature |
| Löslichkeit | H2O: 50 mg/mL, clear, colorless |
| Aggregatzustand | Solid |
| pKa (Säurekonstante) | 12.45±0.20(Predicted) |
| Farbe | White to Off-White |
| BRN | 1724622 |
| InChI | InChI=1S/C6H12O6/c7-1-3(9)5(11)6(12)4(10)2-8/h1,3-6,8-12H,2H2/t3-,4+,5+,6-/m1/s1 |
| InChIKey | GZCGUPFRVQAUEE-DPYQTVNSSA-N |
| SMILES | O=C[C@H]([C@@H]([C@@H]([C@H](CO)O)O)O)O |
| LogP (Verteilungskoeffizient) | -3.290 (est) |
| CAS Datenbank | 15572-79-9(CAS DataBase Reference) |
Sicherheit & Vorschriften
| Regulatorische Informationen | L-Galactose: Does not have an individual approval but may be used under an appropriate group standard |
|---|---|
| F | 3-10 |
| Wassergefährdungsklasse (WGK) | 3 |
| Zollcode | 29400000 |
| Sicherheitshinweise (S) | 24/25 |
| Lagerklasse | 11 - Combustible Solids |
Anwendungen & Verwendung
Verwenden
L-Galactose is the L-Isomer of D-galactose (G155250), a C-4 epimer of Glucose (G595000) found in milk and sugar beets as well as being synthesized by the body. Potential use in oral therapy for nephrotic syndrome in foc al and segmental glomerulosclerosis.