HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
N-(Dimethylsilyl)-1,1-dimethylsilylamin
TMDS · TETRAMETHYLDISILAZANE · Bis(dimethylsilyl)amine · Bisdimethylsilylamine · DK097 · Bis(dimethylsilyl) imide · Iminobis(dimethylsilane) · TETRAMETHYLDISILAZANE 98+%
Identifikatoren & physikalische Daten
| CAS No. | 15933-59-2 |
|---|---|
| Summenformel | C4H15NSi2 |
| Durchschnittliche Molmasse | 133,34 g/mol |
| Monoisotopische Masse | 133,07430255 g/mol |
| SMILES | C[SiH](C)N[SiH](C)C |
| InChIKey | NQCZAYQXPJEPDS-UHFFFAOYSA-N |
| PubChem CID | 85196 |
| DTXSID | DTXSID80884860 |
| Lokaler Name | N-(Dimethylsilyl)-1,1-dimethylsilylamin |
Chemische & physikalische Eigenschaften
| Polarare Oberfläche (TPSA) | 12 |
|---|---|
| H-Brücken-Donoren | 1 |
| H-Brücken-Akzeptoren | 1 |
| Frei drehbare Bindungen | 2 |
| Schwere Atome | 7 |
| Formalladung | 0 |
| Komplexität | 39 |
| SpringerMaterials Properties | 29Si nuclear magnetic resonance spectrum |
| Schmelzpunkt | 99-100 °C |
| Siedepunkt | 100 °C |
| Dichte | 0.77 |
| Brechungsindex | 1.41 |
| Flammpunkt | -8 °C |
| Lagerbedingungen | Store below +30°C. |
| Löslichkeit | Miscible with common organic solvents. |
| pKa (Säurekonstante) | 9.80±0.70(Predicted) |
| Aggregatzustand | clear liquid |
| Farbe | Colorless to Almost colorless |
| Wichte | 0.752 |
| BRN | 741869 |
| InChI | 1S/C4H15NSi2/c1-6(2)5-7(3)4/h5-7H,1-4H3 |
| InChIKey | NQCZAYQXPJEPDS-UHFFFAOYSA-N |
| SMILES | [H][Si](C)(C)N[Si]([H])(C)C |
| CAS Datenbank | 15933-59-2(CAS DataBase Reference) |
| EPA chemische Informationen | Silanamine, N-(dimethylsilyl)-1,1-dimethyl- (15933-59-2) |
Sicherheit & Vorschriften
| F | 10-21 |
|---|---|
| Wassergefährdungsklasse (WGK) | 3 |
| TSCA-Inventar-Status | TSCA listed |
| UN-Transportnummer | UN 2924 3/PG 2 |
| Zollcode | 29319090 |
| R-Sätze (R) | 11-36/37/38 |
| Gefahrensymbole | F,Xi |
| Sicherheitshinweise (S) | 16-26-36 |
| Gefahrenklasse | 3Eye Irrit. 2Flam. Liq. 2Skin Irrit. 2STOT SE 3 |
| Verpackungsgruppe | II |
| Lagerklasse | 3 - Flammable liquids |
Anwendungen & Verwendung
Verwenden
1,1,3,3-Tetramethyldisilazane is widely used in intramolecular hydrosilation of allyl alcohols, homoallyl alcohols, and homopropargyl alcohols for the regio- and stereoselective synthesis of polyols