HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
(-)-1-(4-Fluorophenyl)ethanol
(S)-1-(4-fluorophenyl)ethan-1-ol · S-PF-PEL · (-)-1-(4-Fluorophenyl)ethanol · (S)-1-(4-Fluorophenyl)ethanol · (S)-1-(4-Ffluorophenyl)ethanol · (1S)-1-(4-fluorophenyl)ethanol · (S)-1-(4-Fluorophenyl)ethanol98% · (S)-1-(4-Fluorophenyl)ethanol 98%
Identifikatoren & physikalische Daten
| CAS No. | 101219-73-2 |
|---|---|
| Summenformel | C8H9FO |
| Durchschnittliche Molmasse | 140,15 g/mol |
| SMILES | C[C@H](O)c1ccc(F)cc1 |
| InChIKey | PSDSORRYQPTKSV-ISZMHOAENA-N |
| PubChem CID | 852997 |
| EC No. | 624-798-0 |
Chemische & physikalische Eigenschaften
| XLogP | 1,5 |
|---|---|
| Polarare Oberfläche (TPSA) | 20,2 |
| H-Brücken-Donoren | 1 |
| H-Brücken-Akzeptoren | 2 |
| Frei drehbare Bindungen | 1 |
| Schwere Atome | 10 |
| Formalladung | 0 |
| Komplexität | 97,4 |
| Siedepunkt | 216.2±0.0 °C(Predicted) |
| Dichte | 1.111 g/mL at 25 °C |
| Brechungsindex | n20/D 1.502 |
| Lagerbedingungen | Sealed in dry,Room Temperature |
| Aggregatzustand | liquid |
| pKa (Säurekonstante) | 14.36±0.20(Predicted) |
| Farbe | Clear |
| InChI | InChI=1/C8H9FO/c1-6(10)7-2-4-8(9)5-3-7/h2-6,10H,1H3/t6-/s3 |
| InChIKey | PSDSORRYQPTKSV-ISZMHOAENA-N |
| SMILES | C1(=CC=C(F)C=C1)[C@@H](O)C |&1:7,r| |
| CAS Datenbank | 101219-73-2(CAS DataBase Reference) |
Sicherheit & Vorschriften
| Wassergefährdungsklasse (WGK) | 3 |
|---|---|
| Zollcode | 2906290090 |
| R-Sätze (R) | 36/37/38-20/21/22-22 |
| Gefahrensymbole | Xn,Xi |
| hazard_note | Irritant |
| Sicherheitshinweise (S) | 36/37/39-26 |
| Lagerklasse | 10 - Combustible liquids |
| Gefahrenklasse | Acute Tox. 4 OralEye Irrit. 2Skin Irrit. 2STOT SE 3 |
Anwendungen & Verwendung
Verwenden
(S)-4-Fluoro-α-methylbenzyl alcohol can be used as a starting material to synthesize a CCR5 antagonist named MLN1251.Along with its ortho- and non-fluorine substituted analogs, it can be used to study the role of fluorine substitution in chiral discrimination in molecular complexes.