HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Di-tert-butyl N,N-Diisopropylphosphoramidite
DI-TERT-BUTYL DIISOPROPYLPHOSPHORAMIDITE · N,N-diisopropylphosphoraMidite · DI-TERT-BUTYL-N,N-DIISOPROPYLPHOSPHORAMIDITE · Bis(1,1-dimethylethyl) N,N-bis(1-methylethyl)phosphoramidite · 13748-86-8 · di-tert-butyl diisopropylphosphoramide · DIISOPROPYL DI-TERT-BUTYLPHOSPHORAMIDITE · Di-tert-butoxy(diisopropylamino)phosphine
Identifikatoren & physikalische Daten
| CAS No. | 137348-86-8 |
|---|---|
| Summenformel | C14H32NO2P |
| Durchschnittliche Molmasse | 277,38 g/mol |
| Monoisotopische Masse | 277,21706589 g/mol |
| SMILES | CC(C)N(C(C)C)P(OC(C)(C)C)OC(C)(C)C |
| InChIKey | YGFLCNPXEPDANQ-UHFFFAOYSA-N |
| PubChem CID | 853005 |
| EC No. | 627-964-0 |
| DTXSID | DTXSID00357384 |
Chemische & physikalische Eigenschaften
| XLogP | 3,8 |
|---|---|
| Polarare Oberfläche (TPSA) | 21,7 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 3 |
| Frei drehbare Bindungen | 7 |
| Schwere Atome | 18 |
| Formalladung | 0 |
| Komplexität | 217 |
| Siedepunkt | 85-90 °C/0.2 mmHg (lit.) |
| Dichte | 0.879 g/mL at 25 °C (lit.) |
| Brechungsindex | n20/D 1.444(lit.) |
| Flammpunkt | >230 °F |
| Lagerbedingungen | 2-8°C |
| Löslichkeit | Chloroform (Slightly), Methanol (Slightly) |
| pKa (Säurekonstante) | 4.90±0.70(Predicted) |
| Aggregatzustand | Liquid |
| Farbe | Clear colorless |
| BRN | 4858847 |
| Stabilität | Moisture Sensitive |
| InChI | InChI=1S/C14H32NO2P/c1-11(2)15(12(3)4)18(16-13(5,6)7)17-14(8,9)10/h11-12H,1-10H3 |
| InChIKey | YGFLCNPXEPDANQ-UHFFFAOYSA-N |
| SMILES | P(N(C(C)C)C(C)C)(OC(C)(C)C)OC(C)(C)C |
| CAS Datenbank | 137348-86-8(CAS DataBase Reference) |
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 40 reports by companies from 3 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| F | 10-23 |
| Wassergefährdungsklasse (WGK) | 3 |
| Zollcode | 29349990 |
| R-Sätze (R) | 36/37/38 |
| Gefahrensymbole | Xi |
| Sicherheitshinweise (S) | 26-36 |
| Lagerklasse | 10 - Combustible liquids |
| Gefahrenklasse | Eye Irrit. 2Skin Irrit. 2STOT SE 3 |
Anwendungen & Verwendung
Verwenden
A phosphinane derivative with immunomodulating activity.