Identifikatoren & physikalische Daten
| CAS No. | 72934-84-0 |
|---|
| Summenformel | C12H13NO2 |
|---|
| Durchschnittliche Molmasse | 203,24 g/mol |
|---|
| SMILES | CC(=O)N1C(=O)C(C)(C)c2ccccc21 |
|---|
| InChIKey | WSBBBRWBBKHEFG-UHFFFAOYSA-N |
|---|
| PubChem CID | 853607 |
|---|
| EC No. | 684-786-6 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 1,7 |
|---|
| Polarare Oberfläche (TPSA) | 37,4 |
|---|
| H-Brücken-Donoren | 0 |
|---|
| H-Brücken-Akzeptoren | 2 |
|---|
| Frei drehbare Bindungen | 0 |
|---|
| Schwere Atome | 15 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 309 |
|---|
Sicherheit & Vorschriften
| GHS-Einstufung | DangerH301 (100%): Toxic if swallowed [Danger Acute toxicity, oral]P261, P264, P270, P272, P280, P301+P316, P302+P352, P321, P330, P333+P317, P362+P364, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 38 reports by companies from 1 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|
| Hazard Classes and Categories | Acute Tox. 3 (100%) |
|---|
