HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Phenol, 4,4'-(1-methylethylidene)bis[2,3,5,6-tetrachloro-
Fatty acids, butter · Enzymatic Hydrolysis of Cream
Identifikatoren & physikalische Daten
| CAS No. | 16669-42-4 |
|---|---|
| Summenformel | C15H8Cl8O2 |
| Durchschnittliche Molmasse | 503,8 g/mol |
| Monoisotopische Masse | 499,803251 g/mol |
| SMILES | CC(C)(c1c(Cl)c(Cl)c(O)c(Cl)c1Cl)c1c(Cl)c(Cl)c(O)c(Cl)c1Cl |
| InChIKey | OJTHLNYBRBMCBW-UHFFFAOYSA-N |
| PubChem CID | 85536 |
| ChEBI | CHEBI:177522 |
| DTXSID | DTXSID9066095 |
Chemische & physikalische Eigenschaften
| XLogP | 9 |
|---|---|
| Polarare Oberfläche (TPSA) | 40,5 |
| H-Brücken-Donoren | 2 |
| H-Brücken-Akzeptoren | 2 |
| Frei drehbare Bindungen | 2 |
| Schwere Atome | 25 |
| Formalladung | 0 |
| Komplexität | 408 |
| FEMA | 2171 | BUTTER ACIDS |
| Geruch | at 100.00 %. butter oily fatty |
| Geruchsart | oily |
| EPA chemische Informationen | Fatty acids, butter (85536-25-0) |
Sicherheit & Vorschriften
| TSCA-Inventar-Status | TSCA listed |
|---|
Anwendungen & Verwendung
Occurrence
Reported found in butter.
Herstellung & Synthese
synthetische
Isolated from butter; mixtures of the acids from other sources.