HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
2,3-Dibrompropionylchlorid
Brn 1749801 · Einecs 242-575-2 · 2.3-Dibromoproionyl chloride · 2,3-dibromo-propionylchlorid · 2,3-dibromopropanoylchloride · 2,3-DIBROMOPROPIONYL CHLORIDE · 2,3-dibromo-propanoyl chlorid · 2,3-DibromopropionylChloride>Propionyl chloride, 2,3-dibromo-
Identifikatoren & physikalische Daten
| CAS No. | 18791-02-1 |
|---|---|
| Summenformel | C3H3Br2ClO |
| Durchschnittliche Molmasse | 250,31 g/mol |
| Monoisotopische Masse | 247,8239166 g/mol |
| SMILES | O=C(Cl)C(Br)CBr |
| InChIKey | HWKWYDXHMQQDQJ-UHFFFAOYSA-N |
| PubChem CID | 86790 |
| EC No. | 242-575-2 |
| DTXSID | DTXSID10940266 |
| Lokaler Name | 2,3-Dibrompropionylchlorid |
Chemische & physikalische Eigenschaften
| XLogP | 2,4 |
|---|---|
| Polarare Oberfläche (TPSA) | 17,1 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 1 |
| Frei drehbare Bindungen | 2 |
| Schwere Atome | 7 |
| Formalladung | 0 |
| Komplexität | 75,3 |
| Siedepunkt | 191-193 °C (lit.) |
| Dichte | 2.181 g/mL at 25 °C (lit.) |
| Brechungsindex | n20/D 1.542(lit.) |
| Flammpunkt | 152 °F |
| Lagerbedingungen | RT, stored under nitrogen |
| Aggregatzustand | Liquid |
| Farbe | Clear colorless to yellow |
| BRN | 1749801 |
| InChI | InChI=1S/C3H3Br2ClO/c4-1-2(5)3(6)7/h2H,1H2 |
| InChIKey | HWKWYDXHMQQDQJ-UHFFFAOYSA-N |
| SMILES | C(Cl)(=O)C(Br)CBr |
| CAS Datenbank | 18791-02-1(CAS DataBase Reference) |
Sicherheit & Vorschriften
| GHS-Einstufung | DangerH302 (97.9%): Harmful if swallowed [Warning Acute toxicity, oral]P260, P261, P264, P270, P271, P280, P301+P317, P301+P330+P331, P302+P361+P354, P304+P340, P305+P354+P338, P316, P319, P321, P330, P363, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 47 reports by companies from 7 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (97.9%) |
| F | 19-21 |
| Wassergefährdungsklasse (WGK) | 3 |
| UN-Transportnummer | UN 3265 8/PG 2 |
| Zollcode | 29159000 |
| RTECS-Nr. | UG6657500 |
| R-Sätze (R) | 34-36/37 |
| Gefahrensymbole | C |
| Sicherheitshinweise (S) | 23-26-27-28-36/37/39-45 |
| Gefahrenklasse | 8Acute Tox. 4 OralEye Dam. 1Skin Corr. 1BSTOT SE 3 |
| Verpackungsgruppe | II |
| Lagerklasse | 8A - Combustible corrosive hazardous materials |
Anwendungen & Verwendung
Verwenden
2,3-Dibromopropionyl chloride was used in synthesis of:series of 2,3-diaminopropionanilidesenantiomers of 1,4-dideoxy-1,4-iminolyxitol and 1,4-dideoxy-1,4-iminoribitolacromelic acid A