Identifikatoren & physikalische Daten
| CAS No. | 419559-57-2 |
|---|
| Summenformel | C17H18ClNO3 |
|---|
| Durchschnittliche Molmasse | 319,8 g/mol |
|---|
| Monoisotopische Masse | 319,0975211 g/mol |
|---|
| SMILES | COc1ccc(CCC(=O)Nc2cc(Cl)ccc2OC)cc1 |
|---|
| InChIKey | FKZNRKCPMRUCGH-UHFFFAOYSA-N |
|---|
| PubChem CID | 868614 |
|---|
| ChEMBL | CHEMBL1408906 |
|---|
| EC No. | 661-167-9 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 3,6 |
|---|
| Polarare Oberfläche (TPSA) | 47,6 |
|---|
| H-Brücken-Donoren | 1 |
|---|
| H-Brücken-Akzeptoren | 3 |
|---|
| Frei drehbare Bindungen | 6 |
|---|
| Schwere Atome | 22 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 345 |
|---|
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH400 (100%): Very toxic to aquatic life [Warning Hazardous to the aquatic environment, acute hazard]P273, P391, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 38 reports by companies from 1 notifications to the ECHA C&L Inventory. |
|---|
| Hazard Classes and Categories | Aquatic Acute 1 (100%) |
|---|
