HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
2-(Hydroxymethyl)anthrachinon
ANTHRAQUINONE-2-METHANOL · 2-(Hydroxymethyl)anthraquinone · 2-(Hydroxymethyl)anthraouinone · 2-(hydroxymethyl)-anthraquinon · 2-(Hydroxymethyl)anthraquinone,97% · 2-HYDROXYMETHYL-9,10-ANTHRACENEDIONE · 2-(HydroxyMethyl)anthracene-9,10-dione · 2-(HydroxyMethyl)anthraquinone, 97% 5GR
Identifikatoren & physikalische Daten
| CAS No. | 17241-59-7 |
|---|---|
| Summenformel | C15H10O3 |
| Durchschnittliche Molmasse | 238,24 g/mol |
| Monoisotopische Masse | 238,06299418 g/mol |
| SMILES | O=C1c2ccccc2C(=O)c2cc(CO)ccc21 |
| InChIKey | JYKHAJGLEVKEAA-UHFFFAOYSA-N |
| PubChem CID | 87014 |
| ChEMBL | CHEMBL21049 |
| ChEBI | CHEBI:28649 |
| EC No. | 241-274-3 |
| DTXSID | DTXSID10169278 |
| Lokaler Name | 2-(Hydroxymethyl)anthrachinon |
Chemische & physikalische Eigenschaften
| XLogP | 2,7 |
|---|---|
| Polarare Oberfläche (TPSA) | 54,4 |
| H-Brücken-Donoren | 1 |
| H-Brücken-Akzeptoren | 3 |
| Frei drehbare Bindungen | 1 |
| Schwere Atome | 18 |
| Formalladung | 0 |
| Komplexität | 363 |
| Schmelzpunkt | 192-197 °C(lit.) |
| Siedepunkt | 340.83°C (rough estimate) |
| Dichte | 1.2068 (rough estimate) |
| Brechungsindex | 1.6000 (estimate) |
| Lagerbedingungen | Sealed in dry,2-8°C |
| Löslichkeit | chloroform/methanol: soluble2%, clear to slightly hazy, colorless to yellow |
| Aggregatzustand | Solid |
| pKa (Säurekonstante) | 14.05±0.10(Predicted) |
| Farbe | light yellow |
| BRN | 2120452 |
| InChI | 1S/C15H10O3/c16-8-9-5-6-12-13(7-9)15(18)11-4-2-1-3-10(11)14(12)17/h1-7,16H,8H2 |
| InChIKey | JYKHAJGLEVKEAA-UHFFFAOYSA-N |
| SMILES | OCc1ccc2C(=O)c3ccccc3C(=O)c2c1 |
| LogP (Verteilungskoeffizient) | 2.200 (est) |
| CAS Datenbank | 17241-59-7(CAS DataBase Reference) |
Sicherheit & Vorschriften
| F | 8 |
|---|---|
| Wassergefährdungsklasse (WGK) | 3 |
| Zollcode | 29146990 |
| RTECS-Nr. | CB7600000 |
| Sicherheitshinweise (S) | 22-24/25 |
| Lagerklasse | 11 - Combustible Solids |
Anwendungen & Verwendung
Verwenden
2-(Hydroxymethyl)anthraquinone (a photoremovable protecting group) was used to chemically cage (Z)-11-hexadecen-1-ol (sex pheromone of Chilo infuscatellus snellen).