HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Kupferbis(dimethyldithiocarbamat)
CDMC · CUMATE · Wolfen · hermatcu · METHYL CUMATE · Compound-4018 · Perkacit CDMC · Akrochem Cu.D.D
Identifikatoren & physikalische Daten
| CAS No. | 137-29-1 |
|---|---|
| Summenformel | C6H12CuN2S4 |
| Durchschnittliche Molmasse | 304 g/mol |
| Monoisotopische Masse | 302,91793 g/mol |
| SMILES | CN(C)C(=S)[S-].CN(C)C(=S)[S-].[Cu+2] |
| InChIKey | ZOUQIAGHKFLHIA-UHFFFAOYSA-L |
| PubChem CID | 8721 |
| Lokaler Name | Kupferbis(dimethyldithiocarbamat) |
Chemische & physikalische Eigenschaften
| Polarare Oberfläche (TPSA) | 72,7 |
|---|---|
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 4 |
| Frei drehbare Bindungen | 0 |
| Schwere Atome | 13 |
| Formalladung | 0 |
| Komplexität | 143 |
| Schmelzpunkt | 260°C |
| Siedepunkt | 415.51°C (estimate) |
| Dichte | 1,75 g/cm3 |
| Dampfdruck | 0Pa at 25℃ |
| Aggregatzustand | powder to crystal |
| Farbe | Orange to Amber to Dark red |
| Wichte | 1.75 |
| InChI | InChI=1S/2C3H7NS2.Cu/c2*1-4(2)3(5)6/h2*1-2H3,(H,5,6)/q+2/p-2 |
| InChIKey | ZOUQIAGHKFLHIA-UHFFFAOYSA-L |
| SMILES | C(=S)(S[Cu]SC(=S)N(C)C)N(C)C |
| LogP (Verteilungskoeffizient) | 4.55 |
| CAS Datenbank | 137-29-1(CAS DataBase Reference) |
| NIST chemische Informationen | Bis(dimethyldithiocarbamato) copper complex(137-29-1) |
| EPA chemische Informationen | Copper dimethyldithiocarbamate (137-29-1) |
Sicherheit & Vorschriften
| TSCA-Inventar-Status | TSCA listed |
|---|---|
| UN-Transportnummer | 3077 |
| Zollcode | 2930200090 |
| RTECS-Nr. | FA0175000 |
| Gefahrenklasse | 9 |
| Verpackungsgruppe | III |
Anwendungen & Verwendung
Verwenden
Copper dimethyldithiocarbamate [137-29-1] is used as an ultraaccelerator or vulcanization agent for SBR (styrenebutadiene), IR (polyisoprene isoprene), and EPDM (ethylene-propylene terpolymer) rubbers. Copper dimethyldithiocarbamate is often used as a stabilizer/antioxidant for synthetic elastomers or polyethers.