HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
1-Brom-2,4-dimethoxybenzol
1-Bromo-2,4-dimethox · 3-Methoxy-4-bromoanisole · 2,4-DIMETHOXYBROMOBENZENE · 2,4-diMethoxylbroMophenol · 2,4-Dimethoxyphenyl bromide · 1,3-Dmethoxy-4-bromobenzene · 1,3-DIMETHOXY-4-BROMOBENZENE · 1-BROMO-2,4-DIMETHOXYBENZENE
Identifikatoren & physikalische Daten
| CAS No. | 17715-69-4 |
|---|---|
| Summenformel | C8H9BrO2 |
| Durchschnittliche Molmasse | 217,06 g/mol |
| Monoisotopische Masse | 215,97859163 g/mol |
| SMILES | COc1ccc(Br)c(OC)c1 |
| InChIKey | NIUZVSQOXJIHBL-UHFFFAOYSA-N |
| PubChem CID | 87266 |
| EC No. | 241-717-0 |
| DTXSID | DTXSID50170262 |
| Lokaler Name | 1-Brom-2,4-dimethoxybenzol |
Chemische & physikalische Eigenschaften
| XLogP | 2,8 |
|---|---|
| Polarare Oberfläche (TPSA) | 18,5 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 2 |
| Frei drehbare Bindungen | 2 |
| Schwere Atome | 11 |
| Formalladung | 0 |
| Komplexität | 119 |
| Schmelzpunkt | 25-26 °C(lit.) |
| Siedepunkt | 153-155 °C18 mm Hg(lit.) |
| Dichte | 1.507 g/mL at 25 °C(lit.) |
| Brechungsindex | n20/D 1.572(lit.) |
| Flammpunkt | >230 °F |
| Lagerbedingungen | Inert atmosphere,Room Temperature |
| Aggregatzustand | Liquid |
| Wichte | 1.507 |
| Farbe | Clear slightly yellow |
| Löslichkeit | insoluble |
| BRN | 1867593 |
| InChI | InChI=1S/C8H9BrO2/c1-10-6-3-4-7(9)8(5-6)11-2/h3-5H,1-2H3 |
| InChIKey | NIUZVSQOXJIHBL-UHFFFAOYSA-N |
| SMILES | C1(Br)=CC=C(OC)C=C1OC |
| CAS Datenbank | 17715-69-4(CAS DataBase Reference) |
| NIST chemische Informationen | Benzene, 1-bromo-2,4-dimethoxy-(17715-69-4) |
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 46 reports by companies from 6 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| Wassergefährdungsklasse (WGK) | 3 |
| Zollcode | 29093090 |
| R-Sätze (R) | 36/37/38 |
| Gefahrensymbole | Xi |
| Sicherheitshinweise (S) | 26-37/39 |
| Gefahrenklasse | IRRITANTEye Irrit. 2Skin Irrit. 2STOT SE 3 |
| Lagerklasse | 10 - Combustible liquids |
Anwendungen & Verwendung
Verwenden
1-Bromo-2,4-dimethoxybenzene was used in the synthesis of 2,3-disubstituted benzo[b]furans. It was also used in the synthesis of dendrimer Si[CH2CH2Si(Me)2-2,4-(MeO)2-C6H3]4.