HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Undecanoylchlorid
Nsc 83585 · Einecs 241-741-1 · Undecane chloride · Undecanoyl chlorid · UNDECANOYL CHLORIDE · Undercanoyl chloride · HENDECANOYL CHLORIDE · UNDECANOYLE CHLORIDE
Identifikatoren & physikalische Daten
| CAS No. | 17746-05-3 |
|---|---|
| Summenformel | C11H21ClO |
| Durchschnittliche Molmasse | 204,73 g/mol |
| Monoisotopische Masse | 204,12809297 g/mol |
| SMILES | CCCCCCCCCCC(=O)Cl |
| InChIKey | JUKPJGZUFHCZQI-UHFFFAOYSA-N |
| PubChem CID | 87287 |
| EC No. | 241-741-1 |
| DTXSID | DTXSID4066258 |
| Lokaler Name | Undecanoylchlorid |
Chemische & physikalische Eigenschaften
| XLogP | 4,6 |
|---|---|
| Polarare Oberfläche (TPSA) | 17,1 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 1 |
| Frei drehbare Bindungen | 9 |
| Schwere Atome | 13 |
| Formalladung | 0 |
| Komplexität | 123 |
| Siedepunkt | 135-136 °C/20 mmHg (lit.) |
| Dichte | 0.93 g/mL at 25 °C(lit.) |
| Brechungsindex | n20/D 1.443(lit.) |
| Flammpunkt | >230 °F |
| Lagerbedingungen | −20°C |
| Löslichkeit | Chloroform (Slightly), Methanol (Slightly) |
| Aggregatzustand | clear liquid |
| Wichte | 0.93 |
| Farbe | Colorless to Light yellow to Light orange |
| BRN | 1759226 |
| Stabilität | Moisture Sensitive |
| InChI | InChI=1S/C11H21ClO/c1-2-3-4-5-6-7-8-9-10-11(12)13/h2-10H2,1H3 |
| InChIKey | JUKPJGZUFHCZQI-UHFFFAOYSA-N |
| SMILES | C(Cl)(=O)CCCCCCCCCC |
| CAS Datenbank | 17746-05-3(CAS DataBase Reference) |
| EPA chemische Informationen | Undecanoyl chloride (17746-05-3) |
Sicherheit & Vorschriften
| GHS-Einstufung | DangerH314 (100%): Causes severe skin burns and eye damage [Danger Skin corrosion/irritation]P260, P264, P280, P301+P330+P331, P302+P361+P354, P304+P340, P305+P354+P338, P316, P321, P363, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 44 reports by companies from 3 notifications to the ECHA C&L Inventory. |
|---|---|
| Regulatorische Informationen | Status: Active Update: 16-03-2023 https://echa.europa.eu/registration-dossier/-/registered-dossier/16825 |
| Hazard Classes and Categories | Skin Corr. 1B (100%) |
| F | 10-19-21 |
| Wassergefährdungsklasse (WGK) | 3 |
| TSCA-Inventar-Status | TSCA listed |
| UN-Transportnummer | UN 3265 8/PG 2 |
| Zollcode | 2915 90 70 |
| R-Sätze (R) | 14-34 |
| Gefahrensymbole | C |
| Sicherheitshinweise (S) | 26-27-36/37/39-45 |
| Gefahrenklasse | 8Eye Dam. 1Skin Corr. 1B |
| Verpackungsgruppe | III |
| Lagerklasse | 8A - Combustible corrosive hazardous materials |
Anwendungen & Verwendung
Verwenden
Undecanoyl chloride has been used in the synthesis of:chrysotrione B, 2-acylcyclopentene-1,3-dione derivative, isolated from the fruiting bodies of the basidiomycete Hygrophorus chrysodon2-methylpentadecan-5-one4-ketotetradecanoic acid