HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
1,3-Diethoxy-1,1,3,3-tetramethyldisiloxan
DK190 · Tetramethyldiethoxydisiloxane · 1,3-DIETHOXYTETRAMETHYLDISILOXANE · 1,3-diethoxy-1,1,3,3-tetramethyl-disiloxan · 1,3-DIETHOXY-1,1,3,3-TETRAMETHYLDISILOXANE · 1,1,3,3-TETRAMETHYL-1,3-DIETHOXYDISILOXANE · Disiloxane,1,3-diethoxy-1,1,3,3-tetramethyl- · 1,1,3,3-TETRAMETHYL-1,3-DIETHOXYDISILOXANE 97%
Identifikatoren & physikalische Daten
| CAS No. | 18420-09-2 |
|---|---|
| Summenformel | C8H22O3Si2 |
| Durchschnittliche Molmasse | 222,43 g/mol |
| Monoisotopische Masse | 222,11074763 g/mol |
| SMILES | CCO[Si](C)(C)O[Si](C)(C)OCC |
| InChIKey | NPOYZXWZANURMM-UHFFFAOYSA-N |
| PubChem CID | 87635 |
| EC No. | 242-298-7 |
| DTXSID | DTXSID5066372 |
| Lokaler Name | 1,3-Diethoxy-1,1,3,3-tetramethyldisiloxan |
Chemische & physikalische Eigenschaften
| Polarare Oberfläche (TPSA) | 27,7 |
|---|---|
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 3 |
| Frei drehbare Bindungen | 6 |
| Schwere Atome | 13 |
| Formalladung | 0 |
| Komplexität | 132 |
| SpringerMaterials Properties | Viscosity |
| Schmelzpunkt | -134°C |
| Siedepunkt | 161 °C (lit.) |
| Dichte | 0.883 g/mL at 25 °C (lit.) |
| Brechungsindex | n20/D 1.389(lit.) |
| Flammpunkt | 110 °F |
| Löslichkeit | Chloroform (Soluble), Methanol (Slightly) |
| Aggregatzustand | Oil |
| Farbe | Colourless |
| Wichte | 0.879 |
| InChI | 1S/C8H22O3Si2/c1-7-9-12(3,4)11-13(5,6)10-8-2/h7-8H2,1-6H3 |
| InChIKey | NPOYZXWZANURMM-UHFFFAOYSA-N |
| SMILES | CCO[Si](C)(C)O[Si](C)(C)OCC |
| EPA chemische Informationen | Disiloxane, 1,3-diethoxy-1,1,3,3-tetramethyl- (18420-09-2) |
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH226 (100%): Flammable liquid and vapor [Warning Flammable liquids]P210, P233, P240, P241, P242, P243, P261, P264, P264+P265, P271, P280, P302+P352, P303+P361+P353, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P370+P378, P403+P233, P403+P235, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 40 reports by companies from 3 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Flam. Liq. 3 (100%) |
| Wassergefährdungsklasse (WGK) | 3 |
| TSCA-Inventar-Status | TSCA listed |
| UN-Transportnummer | UN 1993 3/PG 3 |
| Zollcode | 29319090 |
| R-Sätze (R) | 10-36/37/38 |
| Gefahrensymbole | Xi |
| Sicherheitshinweise (S) | 16-26-36 |
| Lagerklasse | 3 - Flammable liquids |
| Gefahrenklasse | Eye Irrit. 2Flam. Liq. 3Skin Irrit. 2STOT SE 3 |
Anwendungen & Verwendung
Verwenden
1,3-Diethoxy-1,1,3,3-tetramethyldisiloxane is used in preparation of symmetric Alkoxy-substituted Alkyldisiloxanes by alkoxy partial hydrolysis of alkoxysilanes, carbonization and condensation