HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
p-Toluolsulfonylcyanid
TsCN · 4-Methylbenzenesulfonyl cyanide · P-TOLUENESULFONYL CYANIDE · 4-Toluenesulfonyl Cyanide · Benzenesulfonylcyanide, 4-Methyl- · 4-Methylbenzene-1-sulfonyl cyanide · Tos-CN · osyl cyanide
Identifikatoren & physikalische Daten
| CAS No. | 19158-51-1 |
|---|---|
| Summenformel | C8H7NO2S |
| Durchschnittliche Molmasse | 181,21 g/mol |
| Monoisotopische Masse | 181,01974946 g/mol |
| SMILES | Cc1ccc(S(=O)(=O)C#N)cc1 |
| InChIKey | JONIMGVUGJVFQD-UHFFFAOYSA-N |
| PubChem CID | 87946 |
| EC No. | 242-849-1 |
| DTXSID | DTXSID50172685 |
| Lokaler Name | p-Toluolsulfonylcyanid |
Chemische & physikalische Eigenschaften
| XLogP | 2,3 |
|---|---|
| Polarare Oberfläche (TPSA) | 66,3 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 3 |
| Frei drehbare Bindungen | 1 |
| Schwere Atome | 12 |
| Formalladung | 0 |
| Komplexität | 285 |
| Schmelzpunkt | 47-50 °C (lit.) |
| Siedepunkt | 105-106 °C/1 mmHg (lit.) |
| Dichte | 1.3055 (rough estimate) |
| Brechungsindex | 1.5650 (estimate) |
| Flammpunkt | >230 °F |
| Lagerbedingungen | 2-8°C |
| Löslichkeit | Acetonitrile (Slightly), Chloroform (Slightly), DMSO (Sparingly), Ethyl Acetate |
| Aggregatzustand | crystalline solid |
| Farbe | White |
| BRN | 2048159 |
| Stabilität | Hygroscopic, Moisture Sensitive |
| InChI | InChI=1S/C8H7NO2S/c1-7-2-4-8(5-3-7)12(10,11)6-9/h2-5H,1H3 |
| InChIKey | JONIMGVUGJVFQD-UHFFFAOYSA-N |
| SMILES | C1(S(C#N)(=O)=O)=CC=C(C)C=C1 |
| CAS Datenbank | 19158-51-1(CAS DataBase Reference) |
Sicherheit & Vorschriften
| GHS-Einstufung | DangerH312 (100%): Harmful in contact with skin [Warning Acute toxicity, dermal]P260, P261, P264, P264+P265, P271, P280, P301+P330+P331, P302+P352, P302+P361+P354, P304+P340, P305+P354+P338, P316, P317, P321, P362+P364, P363, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 44 reports by companies from 6 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
| F | 10-21 |
| Wassergefährdungsklasse (WGK) | 3 |
| UN-Transportnummer | UN 3261 8/PG 2 |
| Zollcode | 2930909899 |
| R-Sätze (R) | 20/21-34 |
| Gefahrensymbole | C |
| Sicherheitshinweise (S) | 26-27-28-36/37/39-45 |
| Gefahrenklasse | 8Acute Tox. 4 DermalAcute Tox. 4 InhalationEye Dam. 1Skin Corr. 1B |
| Verpackungsgruppe | III |
| Lagerklasse | 8A - Combustible corrosive hazardous materials |
Anwendungen & Verwendung
Verwenden
Tosyl cyanide is used in a free-radical cyanation of B-alkylcatecholboranes. Also used as a component in a hetero-Diels-Alder reaction with 1,3-bis-silyl enol ethers leading to 4-hyroxypyridines.