Identifikatoren & physikalische Daten
| CAS No. | 670271-70-2 |
|---|
| Summenformel | C15H17NO2S |
|---|
| Durchschnittliche Molmasse | 275,4 g/mol |
|---|
| Monoisotopische Masse | 275,09799996 g/mol |
|---|
| SMILES | Cc1cccc(S(=O)(=O)NCCc2ccccc2)c1 |
|---|
| InChIKey | LIORBEFOYWXZGL-UHFFFAOYSA-N |
|---|
| PubChem CID | 890664 |
|---|
| ChEMBL | CHEMBL1408118 |
|---|
| DTXSID | DTXSID501321816 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 3,2 |
|---|
| Polarare Oberfläche (TPSA) | 54,6 |
|---|
| H-Brücken-Donoren | 1 |
|---|
| H-Brücken-Akzeptoren | 3 |
|---|
| Frei drehbare Bindungen | 5 |
|---|
| Schwere Atome | 19 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 355 |
|---|
| Löslichkeit | 35.7 [ug/mL] (The mean of the results at pH 7.4) |
|---|
