HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Morphothion
morphothion · holine · ekatin f · Ekatin M · Morphotox · Morphotox powder · Morphothion powder · Morphothion emulsion
Identifikatoren & physikalische Daten
| CAS No. | 144-41-2 |
|---|---|
| Summenformel | C8H16NO4PS2 |
| Durchschnittliche Molmasse | 285,3 g/mol |
| Monoisotopische Masse | 285,02583662 g/mol |
| SMILES | COP(=S)(OC)SCC(=O)N1CCOCC1 |
| InChIKey | NTHGWXIWFHGPLK-UHFFFAOYSA-N |
| PubChem CID | 8952 |
| EC No. | 205-628-0 |
| DTXSID | DTXSID9042172 |
| Lokaler Name | Morphothion |
Chemische & physikalische Eigenschaften
| XLogP | 0,8 |
|---|---|
| Polarare Oberfläche (TPSA) | 105 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 6 |
| Frei drehbare Bindungen | 5 |
| Schwere Atome | 16 |
| Formalladung | 0 |
| Komplexität | 275 |
| Schmelzpunkt | 65°C |
| Siedepunkt | 401.1±55.0 °C(Predicted) |
| Dichte | 1.348±0.06 g/cm3(Predicted) |
| Lagerbedingungen | -20°C Freezer, Under inert atmosphere |
| Löslichkeit | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| pKa (Säurekonstante) | -1.25±0.20(Predicted) |
| Aggregatzustand | solid |
| Farbe | White to Off-White |
| EPA chemische Informationen | Morphothion (144-41-2) |
Sicherheit & Vorschriften
| GHS-Einstufung | DangerH301: Toxic if swallowed [Danger Acute toxicity, oral]P261, P262, P264, P270, P271, P273, P280, P301+P316, P302+P352, P304+P340, P316, P321, P330, P361+P364, P391, P403+P233, P405, and P501 (click each P-code to see the statement)P264, P270, P301+P316, P321, P330, P405, and P501 (click each P-code to see the statement) |
|---|---|
| Hazard Classes and Categories | Acute toxicity - category 3Acute toxicity (Oral) - Category 3Acute Tox. 3 * |
| UN-Transportnummer | 2783 |
| R-Sätze (R) | 23/24/25-50/53 |
| Gefahrensymbole | T,N |
| Sicherheitshinweise (S) | 13-45-60-61 |
| Gefahrenklasse | 6.1(b) |
| Verpackungsgruppe | III |
Anwendungen & Verwendung
Verwenden
Morphothion is used inpesticidal compounds.