HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
29H,31H-Phthalocyanin
H2PC · 29H,31H-PHTHALOCYANINE · CI-74100 · polymonblueg · lionolbluekw · ycloeicosine · heliogenblueg · Blue Pigment B
Identifikatoren & physikalische Daten
| CAS No. | 574-93-6 |
|---|---|
| Summenformel | C32H18N8 |
| Durchschnittliche Molmasse | 514,5 g/mol |
| Monoisotopische Masse | 514,16544261 g/mol |
| SMILES | c1ccc2c(c1)-c1nc3nc(nc4[nH]c([nH]c5nc(nc-2n1)-c1ccccc1-5)c1ccccc41)-c1ccccc1-3 |
| InChIKey | IEQIEDJGQAUEQZ-UHFFFAOYSA-N |
| PubChem CID | 8979 |
| Lokaler Name | 29H,31H-Phthalocyanin |
Chemische & physikalische Eigenschaften
| XLogP | 6,4 |
|---|---|
| Polarare Oberfläche (TPSA) | 109 |
| H-Brücken-Donoren | 2 |
| H-Brücken-Akzeptoren | 6 |
| Frei drehbare Bindungen | 0 |
| Schwere Atome | 40 |
| Formalladung | 0 |
| Komplexität | 917 |
| Schmelzpunkt | >300 °C (dec.)(lit.) |
| Siedepunkt | 590.15°C (rough estimate) |
| Dichte | 1.6931 (rough estimate) |
| Brechungsindex | 1.9320 (estimate) |
| Lagerbedingungen | under inert gas (nitrogen or Argon) at 2–8 °C |
| Löslichkeit | DMF: solubleInsoluble in water. |
| Aggregatzustand | Powder |
| Farbe | blue black |
| BRN | 378323 |
| Kosmetik-Inhaltsstoffe Funktionen | COLORANT |
| InChIKey | IEQIEDJGQAUEQZ-UHFFFAOYSA-N |
| SMILES | C1C2=C(C3N([H])C2=NC2=NC(C4=C2C=CC=C4)=NC2N([H])C(=C4C=2C=CC=C4)N=C2N=C(C4=C2C=CC=C4)N=3)C=CC=1 |c:19,33,t:7,45| |
| LogP (Verteilungskoeffizient) | 9.620 (est) |
| EPA chemische Informationen | 29H,31H-Phthalocyanine (574-93-6) |
Sicherheit & Vorschriften
| Wassergefährdungsklasse (WGK) | 3 |
|---|---|
| TSCA-Inventar-Status | TSCA listed |
| Zollcode | 29339900 |
| Sicherheitshinweise (S) | 22-24/25 |
| Lagerklasse | 11 - Combustible Solids |
| Gefahrstoffdaten | 574-93-6(Hazardous Substances Data) |
Anwendungen & Verwendung
Verwenden
Phthalocyanine is a common macrocylic blue-green dye able to form coordination complexes with many elements on the periodic table.