HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
5-Chlor-2-[(2,2,2-trifluorethyl)amino]benzophenon
Einecs 245-199-7 · 5-chloro-2-[(2,2,2-trifluoroethyl)amino]benzophenone · 2-[N-(2,2,2-Trifluoroethyl)amino]-5-chlorobenzophenone · [5-Chloro-2-[(2,2,2-trifluoroethyl)amino]phenyl]phenyl ketone · [5-chloro-2-(2,2,2-trifluoroethylamino)phenyl]-phenylmethanone · Methanone, [5-chloro-2-[(2,2,2-trifluoroethyl)amino]phenyl]phenyl-
![Molekülstruktur von 5-Chlor-2-[(2,2,2-trifluorethyl)amino]benzophenon](/img/chemical/89821.png)
Identifikatoren & physikalische Daten
| CAS No. | 22753-80-6 |
|---|---|
| Summenformel | C15H11ClF3NO |
| Durchschnittliche Molmasse | 313,7 g/mol |
| Monoisotopische Masse | 313,0481262 g/mol |
| SMILES | O=C(c1ccccc1)c1cc(Cl)ccc1NCC(F)(F)F |
| InChIKey | MKBQTVZIYPYTSC-UHFFFAOYSA-N |
| PubChem CID | 89821 |
| EC No. | 245-199-7 |
| DTXSID | DTXSID40177301 |
| Lokaler Name | 5-Chlor-2-[(2,2,2-trifluorethyl)amino]benzophenon |
Chemische & physikalische Eigenschaften
| XLogP | 5,5 |
|---|---|
| Polarare Oberfläche (TPSA) | 29,1 |
| H-Brücken-Donoren | 1 |
| H-Brücken-Akzeptoren | 5 |
| Frei drehbare Bindungen | 4 |
| Schwere Atome | 21 |
| Formalladung | 0 |
| Komplexität | 355 |
| Kovats Retention Index | 196819752000 |
| Schmelzpunkt | 99-100 °C |
| Siedepunkt | 435.2±45.0 °C(Predicted) |
| Dichte | 1.353±0.06 g/cm3(Predicted) |
| pKa (Säurekonstante) | -1.38±0.50(Predicted) |
| Hauptanwendungen | pharmaceutical (small molecule) |
| InChI | 1S/C15H11ClF3NO/c16-11-6-7-13(20-9-15(17,18)19)12(8-11)14(21)10-4-2-1-3-5-10/h1-8,20H,9H2 |
| InChIKey | MKBQTVZIYPYTSC-UHFFFAOYSA-N |
| SMILES | FC(F)(F)CNc1c(cc(cc1)Cl)C(=O)c2ccccc2 |
Sicherheit & Vorschriften
| Wassergefährdungsklasse (WGK) | WGK 3 |
|---|---|
| Lagerklasse | 11 - Combustible Solids |
Anwendungen & Verwendung
Verwenden
2-(2,2,2-Trifluoroethylamino)-5-chlorobenzophenone is a benzophenone derivative with the potential to act as a photo-initiator in applications involving the prevention of UV light damage on polymer films.