Identifikatoren & physikalische Daten
| CAS No. | 446870-48-0 |
|---|
| Summenformel | C14H12N2O2S |
|---|
| Durchschnittliche Molmasse | 272,32 g/mol |
|---|
| Monoisotopische Masse | 272,0619488 g/mol |
|---|
| SMILES | COc1cccc(-n2cnc3sc(C)cc3c2=O)c1 |
|---|
| InChIKey | AHVWYBKPFASMTI-UHFFFAOYSA-N |
|---|
| PubChem CID | 899014 |
|---|
| ChEMBL | CHEMBL1341991 |
|---|
| DTXSID | DTXSID701326129 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 2,8 |
|---|
| Polarare Oberfläche (TPSA) | 70,1 |
|---|
| H-Brücken-Donoren | 0 |
|---|
| H-Brücken-Akzeptoren | 4 |
|---|
| Frei drehbare Bindungen | 2 |
|---|
| Schwere Atome | 19 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 388 |
|---|
| Löslichkeit | 40.3 [ug/mL] (The mean of the results at pH 7.4) |
|---|
![Molekülstruktur von 3-(3-Methoxyphenyl)-6-methylthieno[2,3-d]pyrimidin-4-one](/img/chemical/899014.png)