Identifikatoren & physikalische Daten
| CAS No. | 713096-74-3 |
|---|
| Summenformel | C15H23NO3S |
|---|
| Durchschnittliche Molmasse | 297,4 g/mol |
|---|
| Monoisotopische Masse | 297,13986477 g/mol |
|---|
| SMILES | CCOc1cc(C)c(S(=O)(=O)N2CCCCC2)cc1C |
|---|
| InChIKey | NEJFQZSQWIGLCC-UHFFFAOYSA-N |
|---|
| PubChem CID | 899243 |
|---|
| ChEMBL | CHEMBL1465594 |
|---|
| DTXSID | DTXSID701332273 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 3 |
|---|
| Polarare Oberfläche (TPSA) | 55 |
|---|
| H-Brücken-Donoren | 0 |
|---|
| H-Brücken-Akzeptoren | 4 |
|---|
| Frei drehbare Bindungen | 4 |
|---|
| Schwere Atome | 20 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 398 |
|---|
| Löslichkeit | 14.5 [ug/mL] (The mean of the results at pH 7.4) |
|---|
