HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
6,7-dimethyl-4-methylene-3-phenyl-3,4-dihydro-2(1H)-quinazolinone
6,7-dimethyl-4-methylene-3-phenyl-3,4-dihydro-2(1H)-quinazolinone · 2(1H)-Quinazolinone, 3,4-dihydro-6,7-dimethyl-4-methylene-3-phenyl-
Identifikatoren & physikalische Daten
| CAS No. | 351225-43-9 |
|---|---|
| Summenformel | C17H16N2O |
| Durchschnittliche Molmasse | 264,32 g/mol |
| Monoisotopische Masse | 264,12626314 g/mol |
| SMILES | C=C1c2cc(C)c(C)cc2NC(=O)N1c1ccccc1 |
| InChIKey | ORPWCBBBYPPRIJ-UHFFFAOYSA-N |
| PubChem CID | 899340 |
| ChEMBL | CHEMBL1386596 |
| DTXSID | DTXSID901322054 |
Chemische & physikalische Eigenschaften
| XLogP | 3,6 |
|---|---|
| Polarare Oberfläche (TPSA) | 32,3 |
| H-Brücken-Donoren | 1 |
| H-Brücken-Akzeptoren | 1 |
| Frei drehbare Bindungen | 1 |
| Schwere Atome | 20 |
| Formalladung | 0 |
| Komplexität | 400 |
| Löslichkeit | 24.4 [ug/mL] (The mean of the results at pH 7.4) |
| Siedepunkt | 471.2±45.0 °C(Predicted) |
| Dichte | 1.21±0.1 g/cm3(Predicted) |
| pKa (Säurekonstante) | 14.03±0.20(Predicted) |