Identifikatoren & physikalische Daten
| CAS No. | 263390-47-2 |
|---|
| Summenformel | C12H8F3NOS |
|---|
| Durchschnittliche Molmasse | 271,26 g/mol |
|---|
| Monoisotopische Masse | 271,02786954 g/mol |
|---|
| SMILES | Oc1cccnc1Sc1cccc(C(F)(F)F)c1 |
|---|
| InChIKey | VYSNJZIAYAHDLB-UHFFFAOYSA-N |
|---|
| PubChem CID | 902004 |
|---|
| ChEMBL | CHEMBL1735927 |
|---|
| DTXSID | DTXSID201326605 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 3,8 |
|---|
| Polarare Oberfläche (TPSA) | 58,4 |
|---|
| H-Brücken-Donoren | 1 |
|---|
| H-Brücken-Akzeptoren | 6 |
|---|
| Frei drehbare Bindungen | 2 |
|---|
| Schwere Atome | 18 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 275 |
|---|
| Löslichkeit | 38.2 [ug/mL] (The mean of the results at pH 7.4) |
|---|
![Molekülstruktur von 2-{[3-(Trifluoromethyl)phenyl]sulfanyl}-3-pyridinol](/img/chemical/902004.png)