HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
4-Brom-2,6-xylidin
4-BROMO-2,6-XYLIDINE · 2,6-Dimethyl-4-bromoaniline · 4-Bromo-2,6-dimethyl-phenylamine · 6-diMethylaniline · TIMTEC-BB SBB002410 · 4-Bromo-2,6-dimethyl · LABOTEST-BB LT01143222 · 2,6-Xylidine, 4-bromo-
Identifikatoren & physikalische Daten
| CAS No. | 24596-19-8 |
|---|---|
| Summenformel | C8H10BrN |
| Durchschnittliche Molmasse | 200,08 g/mol |
| Monoisotopische Masse | 198,99966142 g/mol |
| SMILES | Cc1cc(Br)cc(C)c1N |
| InChIKey | QGLAYJCJLHNIGJ-UHFFFAOYSA-N |
| PubChem CID | 90549 |
| EC No. | 246-337-9 |
| DTXSID | DTXSID40179345 |
| Lokaler Name | 4-Brom-2,6-xylidin |
Chemische & physikalische Eigenschaften
| XLogP | 2,7 |
|---|---|
| Polarare Oberfläche (TPSA) | 26 |
| H-Brücken-Donoren | 1 |
| H-Brücken-Akzeptoren | 1 |
| Frei drehbare Bindungen | 0 |
| Schwere Atome | 10 |
| Formalladung | 0 |
| Komplexität | 104 |
| SpringerMaterials Properties | 15N nuclear magnetic resonance spectrum |
| Schmelzpunkt | 48-51 °C (lit.) |
| Siedepunkt | 120°C 0,2mm |
| Dichte | 1.4423 (rough estimate) |
| Brechungsindex | 1.5748 (estimate) |
| Flammpunkt | >230 °F |
| Lagerbedingungen | Keep in dark place,Inert atmosphere,Room temperature |
| Löslichkeit | Chloroform, Methanol |
| pKa (Säurekonstante) | 3.60±0.10(Predicted) |
| Aggregatzustand | Liquid |
| Farbe | Clear yellow to orange to amber |
| BRN | 1936300 |
| InChI | InChI=1S/C8H10BrN/c1-5-3-7(9)4-6(2)8(5)10/h3-4H,10H2,1-2H3 |
| InChIKey | QGLAYJCJLHNIGJ-UHFFFAOYSA-N |
| SMILES | C1(N)=C(C)C=C(Br)C=C1C |
| CAS Datenbank | 24596-19-8(CAS DataBase Reference) |
| NIST chemische Informationen | Benzenamine, 4-bromo-2,6-dimethyl-(24596-19-8) |
Sicherheit & Vorschriften
| GHS-Einstufung | DangerH302 (18.4%): Harmful if swallowed [Warning Acute toxicity, oral]P233, P260, P261, P264, P264+P265, P270, P271, P280, P284, P301+P317, P302+P352, P304+P340, P305+P351+P338, P317, P319, P321, P330, P332+P317, P337+P317, P342+P316, P362+P364, P403, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 49 reports by companies from 8 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (18.4%) |
| F | 8-10-23 |
| Wassergefährdungsklasse (WGK) | 3 |
| UN-Transportnummer | UN2811/6.1/III |
| Zollcode | 29214990 |
| R-Sätze (R) | 38-43-36/37/38-20/21/22 |
| Gefahrensymbole | Xi,Xn |
| hazard_note | Harmful |
| Sicherheitshinweise (S) | 36/37-36/37/39-26 |
| Gefahrenklasse | 6.1Acute Tox. 3 DermalAcute Tox. 3 InhalationAcute Tox. 4 OralAquatic Acute 1Aquatic Chronic 1Carc. 2Skin Irrit. 2STOT SE 3 |
| Lagerklasse | 6.1C - Combustible acute toxic Cat.3toxic compounds or compounds which causing chronic effects |
Anwendungen & Verwendung
Verwenden
4-Bromo-2,6-dimethylaniline has been used in the preparation of:4-bromo-N-(1-(6-(1-isopropyl-1H-benzo[d]imidazol-2-yl)pyridin-2-yl)ethylidene)-2,6-dimethylbenzenamineN-(4-Bromo-2,6-dimethylphenyl)-5-trimethylammoniumsalicylaldimine chlorideethynyl-functionalized persistent perylene diimide-multichromophore