HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Allyltributylstannan
ALLYLTRIBUTYLSTANNANE · ALLYLTRI-N-BUTYLTIN · Tributylallylstannane · allyltri-n-butylstannane · 2-Propenyltributylstannane · TRIBUTYL-2-PROPENYLSTANNANE · tributyl(prop-2-enyl)stannane · SKL1093
Identifikatoren & physikalische Daten
| CAS No. | 24850-33-7 |
|---|---|
| Summenformel | C15H32Sn |
| Durchschnittliche Molmasse | 331,12 g/mol |
| Monoisotopische Masse | 332,15259572 g/mol |
| SMILES | C=C[CH2][Sn]([CH2]CCC)([CH2]CCC)[CH2]CCC |
| InChIKey | YLGRTLMDMVAFNI-UHFFFAOYSA-N |
| PubChem CID | 90628 |
| EC No. | 246-494-3 |
| DTXSID | DTXSID50179553 |
| Lokaler Name | Allyltributylstannan |
Chemische & physikalische Eigenschaften
| Polarare Oberfläche (TPSA) | 0 |
|---|---|
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 0 |
| Frei drehbare Bindungen | 11 |
| Schwere Atome | 16 |
| Formalladung | 0 |
| Komplexität | 141 |
| Endocrine Disruptors | Potential endocrine disrupting compound |
| Schmelzpunkt | 134-135 °C |
| Siedepunkt | 88-92 °C0.2 mm Hg(lit.) |
| Dichte | 1.068 g/mL at 25 °C(lit.) |
| Brechungsindex | n20/D 1.486(lit.) |
| Flammpunkt | >230 °F |
| Lagerbedingungen | 2-8°C |
| Löslichkeit | Chloroform (Slightly), Methanol (Slightly)Immiscible with water. |
| Aggregatzustand | Liquid |
| Farbe | Clear colorless |
| Wichte | 1.068 |
| BRN | 3588340 |
| Stabilität | Air Sensitive |
| InChI | 1S/3C4H9.C3H5.Sn/c3*1-3-4-21-3-2/h3*1,3-4H2,2H33H,1-2H2 |
| InChIKey | YLGRTLMDMVAFNI-UHFFFAOYSA-N |
| SMILES | CCCC[Sn](CCCC)(CCCC)CC=C |
| CAS Datenbank | 24850-33-7(CAS DataBase Reference) |
| NIST chemische Informationen | Allyltributyltin(24850-33-7) |
Sicherheit & Vorschriften
| GHS-Einstufung | DangerH301 (100%): Toxic if swallowed [Danger Acute toxicity, oral]P260, P264, P264+P265, P270, P273, P280, P301+P316, P302+P352, P305+P351+P338, P317, P319, P321, P330, P332+P317, P337+P317, P362+P364, P391, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 47 reports by companies from 7 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Regulatorische Informationen | Stannane, tributyl-2-propenyl-: Does not have an individual approval but may be used under an appropriate group standard |
| Hazard Classes and Categories | Acute Tox. 3 (100%) |
| F | 13 |
| Wassergefährdungsklasse (WGK) | 3 |
| TSCA-Inventar-Status | No |
| UN-Transportnummer | UN 2788 6.1/PG 2 |
| Zollcode | 29319019 |
| R-Sätze (R) | 21-25-36/38-48/23/25-50/53-23/24/25 |
| Gefahrensymbole | T,N |
| Sicherheitshinweise (S) | 35-36/37/39-45-60-61-28-27-26 |
| Gefahrenklasse | 6.1Acute Tox. 3 OralAcute Tox. 4 DermalAquatic Acute 1Aquatic Chronic 1Eye Irrit. 2Repr. 1BSkin Irrit. 2STOT RE 1 |
| Verpackungsgruppe | II |
| Lagerklasse | 6.1C - Combustible acute toxic Cat.3toxic compounds or compounds which causing chronic effects |
Anwendungen & Verwendung
Verwenden
Allylation reagent for aldehydes catalyzed by chiral Lewis acids1,2 and ytterbium(III) trifluoromethanesulfonate (cat. no. 430595).3 Undergoes tetrakis(triphenylphosphine)palladium(0) (cat. no. 216666) catalyzed coupling with iodoquinones4 and allyl acetates.5,6Efficient allylation of aldehydes leading to homoallylic alcohols with trichloro-1,3,5-triazene.7